The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
18-epi-Latrunculol A ID: ALA521352
PubChem CID: 25150440
Max Phase: Preclinical
Molecular Formula: C22H33NO7S
Molecular Weight: 455.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C1=C/C(=O)O[C@@H]2C[C@@H](CC[C@H](C)/C=C\[C@H](O)[C@@H](O)CC1)O[C@@](O)([C@H]1CSC(=O)N1)C2
Standard InChI: InChI=1S/C22H33NO7S/c1-13-3-6-15-10-16(11-22(28,30-15)19-12-31-21(27)23-19)29-20(26)9-14(2)5-8-18(25)17(24)7-4-13/h4,7,9,13,15-19,24-25,28H,3,5-6,8,10-12H2,1-2H3,(H,23,27)/b7-4-,14-9-/t13-,15+,16+,17-,18-,19+,22+/m0/s1
Standard InChI Key: JIGPCDTWTJZFFF-BMXFWCHBSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
13.0167 -15.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0167 -15.9708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7287 -16.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4407 -15.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7287 -14.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3010 -14.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2986 -13.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5829 -13.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5805 -12.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2937 -12.2604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0094 -12.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7227 -12.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4384 -12.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1516 -12.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8673 -12.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5805 -12.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8697 -13.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1564 -13.9021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1589 -14.7271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4408 -13.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4456 -15.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8696 -13.9146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7208 -15.5542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7320 -17.2046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0669 -17.6927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3256 -18.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1507 -18.4721 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.4017 -17.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8439 -19.1458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4417 -16.7875 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.3000 -15.5542 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.1542 -15.5500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.0118 -13.4958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7203 -11.4313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
15 17 2 0
7 8 1 0
17 18 1 0
2 3 1 0
18 19 1 0
8 9 1 0
18 20 2 0
3 4 1 0
21 19 1 0
9 10 2 0
8 22 1 6
4 21 1 0
3 23 1 1
24 25 1 0
10 11 1 0
21 5 1 0
11 12 1 0
1 2 1 0
12 13 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
3 24 1 0
1 6 1 0
26 29 2 0
13 14 1 0
24 30 1 6
1 31 1 1
14 15 1 0
21 32 1 6
6 7 1 0
11 33 1 1
15 16 1 0
12 34 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.57Molecular Weight (Monoisotopic): 455.1978AlogP: 2.03#Rotatable Bonds: 1Polar Surface Area: 125.32Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.35CX Basic pKa: ┄CX LogP: 2.37CX LogD: 2.37Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: 3.14
References 1. Amagata T, Johnson TA, Cichewicz RH, Tenney K, Mooberry SL, Media J, Edelstein M, Valeriote FA, Crews P.. (2008) Interrogating the bioactive pharmacophore of the latrunculin chemotype by investigating the metabolites of two taxonomically unrelated sponges., 51 (22): [PMID:18942825 ] [10.1021/jm8008585 ] 2. Sashidhara KV, White KN, Crews P.. (2009) A selective account of effective paradigms and significant outcomes in the discovery of inspirational marine natural products., 72 (3): [PMID:19209899 ] [10.1021/np800817y ]