The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
biphenyl-4-carboxylic acid methyl-[(3-nitro-4-thiomorpholin-4-yl-phenyl-carbamoyl)-methyl]-amide ID: ALA521427
PubChem CID: 44567885
Max Phase: Preclinical
Molecular Formula: C26H26N4O4S
Molecular Weight: 490.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(CC(=O)Nc1ccc(N2CCSCC2)c([N+](=O)[O-])c1)C(=O)c1ccc(-c2ccccc2)cc1
Standard InChI: InChI=1S/C26H26N4O4S/c1-28(26(32)21-9-7-20(8-10-21)19-5-3-2-4-6-19)18-25(31)27-22-11-12-23(24(17-22)30(33)34)29-13-15-35-16-14-29/h2-12,17H,13-16,18H2,1H3,(H,27,31)
Standard InChI Key: TUYNZLREPSCMCV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-2.6549 -0.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6549 -1.7423 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.9419 -2.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2289 -1.7423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2289 -0.9167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9419 -0.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5122 -0.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1987 -0.9247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9108 -0.5126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9136 0.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1985 0.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5148 0.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2323 0.7254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9470 0.3132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2340 1.5509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6297 0.7233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3445 0.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0606 0.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3432 -0.5140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7755 0.3091 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4916 0.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7742 -0.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2064 0.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4929 1.5443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2020 -0.5196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9118 -0.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6289 -0.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6276 0.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9131 0.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3411 -0.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3395 -1.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0540 -2.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7705 -1.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7681 -0.9305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0530 -0.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 17 1 0
1 6 1 0
17 18 1 0
8 9 1 0
17 19 2 0
2 3 1 0
18 20 1 0
9 10 2 0
20 21 1 0
3 4 1 0
20 22 1 0
10 11 1 0
21 23 1 0
4 5 1 0
21 24 2 0
11 12 2 0
23 25 2 0
12 7 1 0
25 26 1 0
5 6 1 0
26 27 2 0
27 28 1 0
5 7 1 0
28 29 2 0
29 23 1 0
13 14 2 0
13 15 1 0
30 31 2 0
12 13 1 0
31 32 1 0
1 2 1 0
32 33 2 0
10 16 1 0
33 34 1 0
7 8 2 0
34 35 2 0
35 30 1 0
27 30 1 0
M CHG 2 13 1 15 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.59Molecular Weight (Monoisotopic): 490.1675AlogP: 4.53#Rotatable Bonds: 7Polar Surface Area: 95.79Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.50CX Basic pKa: ┄CX LogP: 4.24CX LogD: 4.24Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -1.97
References 1. Dömling A, Antuch W, Beck B, Schauer-Vukasinović V.. (2008) Isosteric exchange of the acylsulfonamide moiety in Abbott's Bcl-XL protein interaction antagonist., 18 (14): [PMID:18583128 ] [10.1016/j.bmcl.2008.05.096 ]