N-(4-(7-methyl-6-oxo-1-(3-phenylpropyl)-5,6-dihydro-1H-imidazo[4,5-g]quinoxalin-2-yl)phenyl)acetamide

ID: ALA521476

PubChem CID: 44190492

Max Phase: Preclinical

Molecular Formula: C27H25N5O2

Molecular Weight: 451.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccc(-c2nc3cc4[nH]c(=O)c(C)nc4cc3n2CCCc2ccccc2)cc1

Standard InChI:  InChI=1S/C27H25N5O2/c1-17-27(34)31-22-15-24-25(16-23(22)28-17)32(14-6-9-19-7-4-3-5-8-19)26(30-24)20-10-12-21(13-11-20)29-18(2)33/h3-5,7-8,10-13,15-16H,6,9,14H2,1-2H3,(H,29,33)(H,31,34)

Standard InChI Key:  RGYJUDSQOIKHIS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -0.3553  -11.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3553  -12.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3592  -12.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3592  -11.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6287  -11.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1438  -12.5143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0698  -11.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0698  -12.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7843  -12.6719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4987  -12.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4987  -11.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7843  -11.0219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2132  -11.0219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2132  -12.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4537  -11.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8662  -11.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6912  -11.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1037  -11.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6912  -12.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8662  -12.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3987  -13.2990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8467  -13.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1016  -14.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5496  -15.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8045  -16.0944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2525  -16.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5545  -16.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8094  -15.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2574  -15.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9287  -11.8469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3412  -11.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9287  -10.4180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1662  -11.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1438  -11.1795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  5 15  1  0
  6  3  1  0
 15 16  2  0
  7  8  2  0
 16 17  1  0
  3  4  1  0
 17 18  2  0
  7  1  1  0
 18 19  1  0
  1  4  2  0
 19 20  2  0
 20 15  1  0
  6 21  1  0
  3  2  2  0
 21 22  1  0
  2  8  1  0
 22 23  1  0
  7 12  1  0
 23 24  1  0
  8  9  1  0
 24 25  2  0
  9 10  2  0
 25 26  1  0
 10 11  1  0
 26 27  2  0
 11 12  1  0
 27 28  1  0
  4 34  1  0
 28 29  2  0
 29 24  1  0
 11 13  2  0
 18 30  1  0
 34  5  2  0
 30 31  1  0
 10 14  1  0
 31 32  2  0
  5  6  1  0
 31 33  1  0
M  END

Associated Targets(Human)

TSSK1B Tchem Testis-specific serine/threonine-protein kinase 1 (2038 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.53Molecular Weight (Monoisotopic): 451.2008AlogP: 4.84#Rotatable Bonds: 6
Polar Surface Area: 92.67Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.34CX Basic pKa: 2.92CX LogP: 4.46CX LogD: 4.46
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.19

References

1. Zhang L, Yan Y, Liu Z, Abliz Z, Liu G..  (2009)  Identification of peptide substrate and small molecule inhibitors of testis-specific serine/threonine kinase1 (TSSK1) by the developed assays.,  52  (14): [PMID:19530700] [10.1021/jm9002846]

Source