The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(7-methyl-6-oxo-1-(3-phenylpropyl)-5,6-dihydro-1H-imidazo[4,5-g]quinoxalin-2-yl)phenyl)acetamide ID: ALA521476
PubChem CID: 44190492
Max Phase: Preclinical
Molecular Formula: C27H25N5O2
Molecular Weight: 451.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1ccc(-c2nc3cc4[nH]c(=O)c(C)nc4cc3n2CCCc2ccccc2)cc1
Standard InChI: InChI=1S/C27H25N5O2/c1-17-27(34)31-22-15-24-25(16-23(22)28-17)32(14-6-9-19-7-4-3-5-8-19)26(30-24)20-10-12-21(13-11-20)29-18(2)33/h3-5,7-8,10-13,15-16H,6,9,14H2,1-2H3,(H,29,33)(H,31,34)
Standard InChI Key: RGYJUDSQOIKHIS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-0.3553 -11.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3553 -12.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3592 -12.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3592 -11.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6287 -11.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1438 -12.5143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0698 -11.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0698 -12.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7843 -12.6719 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4987 -12.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4987 -11.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7843 -11.0219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2132 -11.0219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2132 -12.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4537 -11.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8662 -11.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6912 -11.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1037 -11.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6912 -12.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8662 -12.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3987 -13.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8467 -13.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1016 -14.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5496 -15.3098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8045 -16.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2525 -16.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5545 -16.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8094 -15.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2574 -15.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9287 -11.8469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3412 -11.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9287 -10.4180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1662 -11.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1438 -11.1795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5 15 1 0
6 3 1 0
15 16 2 0
7 8 2 0
16 17 1 0
3 4 1 0
17 18 2 0
7 1 1 0
18 19 1 0
1 4 2 0
19 20 2 0
20 15 1 0
6 21 1 0
3 2 2 0
21 22 1 0
2 8 1 0
22 23 1 0
7 12 1 0
23 24 1 0
8 9 1 0
24 25 2 0
9 10 2 0
25 26 1 0
10 11 1 0
26 27 2 0
11 12 1 0
27 28 1 0
4 34 1 0
28 29 2 0
29 24 1 0
11 13 2 0
18 30 1 0
34 5 2 0
30 31 1 0
10 14 1 0
31 32 2 0
5 6 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.53Molecular Weight (Monoisotopic): 451.2008AlogP: 4.84#Rotatable Bonds: 6Polar Surface Area: 92.67Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.34CX Basic pKa: 2.92CX LogP: 4.46CX LogD: 4.46Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.19
References 1. Zhang L, Yan Y, Liu Z, Abliz Z, Liu G.. (2009) Identification of peptide substrate and small molecule inhibitors of testis-specific serine/threonine kinase1 (TSSK1) by the developed assays., 52 (14): [PMID:19530700 ] [10.1021/jm9002846 ]