2,4-Diamino-6-[N-(2,5-dimethoxybenzyl)-N-ethylamino]quinazoline

ID: ALA521672

PubChem CID: 25099170

Max Phase: Preclinical

Molecular Formula: C19H23N5O2

Molecular Weight: 353.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(Cc1cc(OC)ccc1OC)c1ccc2nc(N)nc(N)c2c1

Standard InChI:  InChI=1S/C19H23N5O2/c1-4-24(11-12-9-14(25-2)6-8-17(12)26-3)13-5-7-16-15(10-13)18(20)23-19(21)22-16/h5-10H,4,11H2,1-3H3,(H4,20,21,22,23)

Standard InChI Key:  ZDKAQGINSFSQDO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    6.2319  -19.1583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2307  -19.9857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9456  -20.3985    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9438  -18.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6591  -19.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6599  -19.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3752  -20.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0902  -19.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0855  -19.1477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3696  -18.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9413  -17.9205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5159  -20.3976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7974  -18.7309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5144  -19.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2263  -18.7222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9410  -19.1338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6525  -18.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6479  -17.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9259  -17.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2174  -17.9023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7924  -17.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0754  -17.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9438  -19.9588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9180  -16.6588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6285  -16.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6597  -20.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
  9 13  1  0
  3  6  2  0
 13 14  1  0
  6  7  1  0
 14 15  1  0
  1  2  2  0
 15 16  2  0
  7  8  2  0
 16 17  1  0
  5  4  2  0
 17 18  2  0
  8  9  1  0
 18 19  1  0
  4  1  1  0
 19 20  2  0
 20 15  1  0
  9 10  2  0
 13 21  1  0
 10  5  1  0
 21 22  1  0
 16 23  1  0
  4 11  1  0
 19 24  1  0
  2  3  1  0
 24 25  1  0
  2 12  1  0
 23 26  1  0
M  END

Associated Targets(non-human)

Dihydrofolate reductase (1239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Dhfr Dihydrofolate reductase (2343 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Dihydrofolate reductase (1637 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
folA Dihydrofolate reductase (350 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 353.43Molecular Weight (Monoisotopic): 353.1852AlogP: 2.84#Rotatable Bonds: 6
Polar Surface Area: 99.52Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.40CX LogP: 2.91CX LogD: 2.62
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.70Np Likeness Score: -0.97

References

1. Gangjee A, Adair OO, Pagley M, Queener SF..  (2008)  N9-substituted 2,4-diaminoquinazolines: synthesis and biological evaluation of lipophilic inhibitors of pneumocystis carinii and toxoplasma gondii dihydrofolate reductase.,  51  (19): [PMID:18771252] [10.1021/jm800694g]

Source