(3-Hydroxy-6-(naphthalen-2-ylamino)picolinoyl)glycine

ID: ALA5218469

PubChem CID: 168298421

Max Phase: Preclinical

Molecular Formula: C18H15N3O4

Molecular Weight: 337.34

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CNC(=O)c1nc(Nc2ccc3ccccc3c2)ccc1O

Standard InChI:  InChI=1S/C18H15N3O4/c22-14-7-8-15(21-17(14)18(25)19-10-16(23)24)20-13-6-5-11-3-1-2-4-12(11)9-13/h1-9,22H,10H2,(H,19,25)(H,20,21)(H,23,24)

Standard InChI Key:  OJQZLQYFPJDTIB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    7.1949  -20.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9093  -20.2952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6238  -20.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3383  -20.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0527  -20.7077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3383  -19.4702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4804  -20.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1949  -21.5326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4853  -19.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0589  -20.2985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7731  -20.7072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0562  -19.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7747  -19.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2018  -19.0601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3459  -20.7135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6300  -20.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6275  -19.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2040  -20.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9196  -20.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1983  -19.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9112  -19.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9111  -18.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1991  -17.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4856  -18.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4891  -19.0752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  1  7  1  0
  1  8  2  0
  7  9  2  0
  9 13  1  0
 12 10  1  0
 10 11  2  0
 11  7  1  0
 12 13  2  0
  9 14  1  0
 10 15  1  0
 15 16  1  0
 16 17  2  0
 17 21  1  0
 20 18  1  0
 18 19  2  0
 19 16  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 20  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5218469

    ---

Associated Targets(Human)

FTO Tchem Alpha-ketoglutarate-dependent dioxygenase FTO (473 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EGLN1 Tclin Egl nine homolog 1 (1702 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HIF1AN Tbio Hypoxia-inducible factor 1-alpha inhibitor (79 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 337.34Molecular Weight (Monoisotopic): 337.1063AlogP: 2.50#Rotatable Bonds: 5
Polar Surface Area: 111.55Molecular Species: ACIDHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 2.43CX Basic pKa: 3.72CX LogP: 2.13CX LogD: -0.44
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.57Np Likeness Score: -0.80

References

1. Shishodia S, Demetriades M, Zhang D, Tam NY, Maheswaran P, Clunie-O'Connor C, Tumber A, Leung IKH, Ng YM, Leissing TM, El-Sagheer AH, Salah E, Brown T, Aik WS, McDonough MA, Schofield CJ..  (2021)  Structure-Based Design of Selective Fat Mass and Obesity Associated Protein (FTO) Inhibitors.,  64  (22.0): [PMID:34762429] [10.1021/acs.jmedchem.1c01204]

Source