The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[3-[[methyl-[7-[4-(4-oxochromen-2-yl)phenoxy]heptyl]amino]methyl]phenyl]N-methylcarbamate ID: ALA5218632
PubChem CID: 168298788
Max Phase: Preclinical
Molecular Formula: C32H36N2O5
Molecular Weight: 528.65
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)Oc1cccc(CN(C)CCCCCCCOc2ccc(-c3cc(=O)c4ccccc4o3)cc2)c1
Standard InChI: InChI=1S/C32H36N2O5/c1-33-32(36)38-27-12-10-11-24(21-27)23-34(2)19-8-4-3-5-9-20-37-26-17-15-25(16-18-26)31-22-29(35)28-13-6-7-14-30(28)39-31/h6-7,10-18,21-22H,3-5,8-9,19-20,23H2,1-2H3,(H,33,36)
Standard InChI Key: NIVUGJNFXBTADH-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
-4.9912 0.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6964 0.5235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6780 1.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3832 1.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3648 2.6017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.1066 1.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8119 1.8087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.5353 1.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.5538 0.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8487 0.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1251 0.5554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4199 0.1271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0096 -0.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3044 -1.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5809 -0.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8757 -1.1897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1522 -0.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4470 -1.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7235 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0183 -1.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7051 -0.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4103 -1.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1338 -0.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8390 -1.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5625 -0.9202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2676 -1.3484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2493 -2.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9545 -2.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6781 -2.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6964 -1.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1250 -1.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1066 -2.2369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8486 -1.0154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5538 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9912 -0.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8207 -2.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5625 0.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2676 0.4918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4199 -0.9837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
11 10 1 0
6 11 2 0
12 2 1 0
11 12 1 0
1 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
17 16 1 0
18 17 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
31 32 2 0
31 33 1 0
33 34 1 0
30 35 1 0
35 26 2 0
24 36 1 0
15 37 2 0
37 38 1 0
38 1 2 0
30 39 1 0
31 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.65Molecular Weight (Monoisotopic): 528.2624AlogP: 6.64#Rotatable Bonds: 13Polar Surface Area: 81.01Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.07CX LogP: 5.96CX LogD: 4.29Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.20Np Likeness Score: -0.45
References 1. Zhang H, Wang Y, Wang Y, Li X, Wang S, Wang Z.. (2022) Recent advance on carbamate-based cholinesterase inhibitors as potential multifunctional agents against Alzheimer's disease., 240 [PMID:35858523 ] [10.1016/j.ejmech.2022.114606 ]