The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 2-oxo-5-(3-(3,4,5-trimethoxyphenyl)acrylamido)-3',6',7',7a'-tetrahydro-1'H-spiro[indoline-3,5'-pyrrolo[1,2-c]thiazole]-6'-carboxylate ID: ALA5218870
PubChem CID: 168298557
Max Phase: Preclinical
Molecular Formula: C30H35N3O7S
Molecular Weight: 581.69
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)Nc2ccc3c(c2)C2(C(=O)N3)C(C(=O)OC(C)(C)C)CC3CSCN32)cc(OC)c1OC
Standard InChI: InChI=1S/C30H35N3O7S/c1-29(2,3)40-27(35)21-14-19-15-41-16-33(19)30(21)20-13-18(8-9-22(20)32-28(30)36)31-25(34)10-7-17-11-23(37-4)26(39-6)24(12-17)38-5/h7-13,19,21H,14-16H2,1-6H3,(H,31,34)(H,32,36)/b10-7+
Standard InChI Key: PWAQGPGZEYEENU-JXMROGBWSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
0.3154 -1.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0300 -0.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7419 -1.0991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7419 -1.9244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0318 -2.3362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3154 -1.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3987 -0.6872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1129 -1.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8270 -0.6872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1129 -1.9242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8270 0.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5413 0.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2556 0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9672 0.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9672 1.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2574 1.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5413 1.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5266 -2.1794 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5267 -0.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0116 -1.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0079 -0.2037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4568 0.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2531 0.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2531 -0.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9382 1.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2118 0.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1686 0.8328 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.7585 -1.5119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2574 2.6105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9716 3.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6815 1.7866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3956 1.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6815 0.1370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6815 -0.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9672 -0.9612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6814 -0.5488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9672 -1.7859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6814 -2.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6814 -3.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3956 -1.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3956 -2.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
1 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
4 18 1 0
3 19 1 0
19 20 1 0
20 18 1 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
19 24 1 0
22 25 1 0
21 26 1 0
26 27 1 0
27 25 1 0
20 28 2 0
16 29 1 0
29 30 1 0
15 31 1 0
31 32 1 0
14 33 1 0
33 34 1 0
24 35 1 0
35 36 2 0
35 37 1 0
37 38 1 0
38 39 1 0
38 40 1 0
38 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 581.69Molecular Weight (Monoisotopic): 581.2196AlogP: 4.25#Rotatable Bonds: 7Polar Surface Area: 115.43Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.57CX Basic pKa: 4.16CX LogP: 3.58CX LogD: 3.58Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.37Np Likeness Score: -0.32
References 1. Lenci E, Baldini L, Trabocchi A.. (2021) Diversity-oriented synthesis as a tool to expand the chemical space of DNA-encoded libraries., 41 [PMID:34030087 ] [10.1016/j.bmc.2021.116218 ]