tert-butyl 2-oxo-5-(3-(3,4,5-trimethoxyphenyl)acrylamido)-3',6',7',7a'-tetrahydro-1'H-spiro[indoline-3,5'-pyrrolo[1,2-c]thiazole]-6'-carboxylate

ID: ALA5218870

PubChem CID: 168298557

Max Phase: Preclinical

Molecular Formula: C30H35N3O7S

Molecular Weight: 581.69

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/C(=O)Nc2ccc3c(c2)C2(C(=O)N3)C(C(=O)OC(C)(C)C)CC3CSCN32)cc(OC)c1OC

Standard InChI:  InChI=1S/C30H35N3O7S/c1-29(2,3)40-27(35)21-14-19-15-41-16-33(19)30(21)20-13-18(8-9-22(20)32-28(30)36)31-25(34)10-7-17-11-23(37-4)26(39-6)24(12-17)38-5/h7-13,19,21H,14-16H2,1-6H3,(H,31,34)(H,32,36)/b10-7+

Standard InChI Key:  PWAQGPGZEYEENU-JXMROGBWSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
    0.3154   -1.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0300   -0.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7419   -1.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7419   -1.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0318   -2.3362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3154   -1.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3987   -0.6872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1129   -1.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8270   -0.6872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1129   -1.9242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8270    0.1374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5413    0.5497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2556    0.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9672    0.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9672    1.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2574    1.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5413    1.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5266   -2.1794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5267   -0.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0116   -1.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0079   -0.2037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4568    0.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2531    0.2743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2531   -0.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9382    1.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2118    0.0096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1686    0.8328    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.7585   -1.5119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2574    2.6105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9716    3.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6815    1.7866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3956    1.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6815    0.1370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6815   -0.6876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9672   -0.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6814   -0.5488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9672   -1.7859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6814   -2.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6814   -3.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3956   -1.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3956   -2.6105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  1  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  2  0
 11 12  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
  4 18  1  0
  3 19  1  0
 19 20  1  0
 20 18  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 19 24  1  0
 22 25  1  0
 21 26  1  0
 26 27  1  0
 27 25  1  0
 20 28  2  0
 16 29  1  0
 29 30  1  0
 15 31  1  0
 31 32  1  0
 14 33  1  0
 33 34  1  0
 24 35  1  0
 35 36  2  0
 35 37  1  0
 37 38  1  0
 38 39  1  0
 38 40  1  0
 38 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5218870

    ---

Associated Targets(Human)

BRD3 Tchem Bromodomain-containing protein 3 (1086 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 581.69Molecular Weight (Monoisotopic): 581.2196AlogP: 4.25#Rotatable Bonds: 7
Polar Surface Area: 115.43Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.57CX Basic pKa: 4.16CX LogP: 3.58CX LogD: 3.58
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.37Np Likeness Score: -0.32

References

1. Lenci E, Baldini L, Trabocchi A..  (2021)  Diversity-oriented synthesis as a tool to expand the chemical space of DNA-encoded libraries.,  41  [PMID:34030087] [10.1016/j.bmc.2021.116218]

Source