The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-acetyl-2-[2-amino-4-(4-ethylpiperazin-1-yl)anilino]-8-cyclopentyl-pteridin-7-one ID: ALA5218932
PubChem CID: 168299158
Max Phase: Preclinical
Molecular Formula: C25H32N8O2
Molecular Weight: 476.59
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCN(c2ccc(Nc3ncc4nc(C(C)=O)c(=O)n(C5CCCC5)c4n3)c(N)c2)CC1
Standard InChI: InChI=1S/C25H32N8O2/c1-3-31-10-12-32(13-11-31)18-8-9-20(19(26)14-18)29-25-27-15-21-23(30-25)33(17-6-4-5-7-17)24(35)22(28-21)16(2)34/h8-9,14-15,17H,3-7,10-13,26H2,1-2H3,(H,27,29,30)
Standard InChI Key: SLHKRPJAPIWNCD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-1.0690 3.0948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3544 3.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3574 3.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3574 2.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3526 1.8583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0690 2.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0720 3.5078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7867 3.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7867 2.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0720 1.8574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5013 1.8574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5013 3.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0720 1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7393 0.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4844 -0.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6596 -0.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4047 0.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7836 1.8537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7836 1.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0690 0.6157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0698 -0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7847 -0.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4965 -0.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5014 0.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7847 -1.4448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0701 -1.8574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0701 -2.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7847 -3.0951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4993 -2.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4993 -1.8574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7847 -3.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0701 -4.3329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5013 4.3329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2159 3.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2159 1.0267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 1 0
4 10 1 0
9 11 2 0
8 12 1 0
10 13 1 0
14 13 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
6 18 1 0
18 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
22 25 1 0
26 25 1 0
27 26 1 0
28 27 1 0
29 28 1 0
30 29 1 0
25 30 1 0
28 31 1 0
31 32 1 0
12 33 2 0
12 34 1 0
24 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.59Molecular Weight (Monoisotopic): 476.2648AlogP: 2.97#Rotatable Bonds: 6Polar Surface Area: 122.27Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.67CX Basic pKa: 8.28CX LogP: 3.01CX LogD: 2.08Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.24
References 1. He H, Liu Q, Chen L, Wang J, Yuan Y, Li H, Qian X, Zhao Z, Chen Z.. (2022) Design, synthesis and biological evaluation of pteridine-7(8H)-one derivatives as potent and selective CDK4/6 inhibitors., 76 [PMID:36130661 ] [10.1016/j.bmcl.2022.128991 ]