4-amino-7-(5-(hydroxymethyl)pyridin-3-yl)quinazoline-6-carboxamide

ID: ALA5219070

PubChem CID: 168298683

Max Phase: Preclinical

Molecular Formula: C15H13N5O2

Molecular Weight: 295.30

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)c1cc2c(N)ncnc2cc1-c1cncc(CO)c1

Standard InChI:  InChI=1S/C15H13N5O2/c16-14-12-2-11(15(17)22)10(3-13(12)19-7-20-14)9-1-8(6-21)4-18-5-9/h1-5,7,21H,6H2,(H2,17,22)(H2,16,19,20)

Standard InChI Key:  AAOFLMYTBOGLRS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
    0.3587    0.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0733    1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7852    0.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7852   -0.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0751   -0.6170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3587   -0.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4979    1.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2146    0.6184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2146   -0.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5030   -0.6193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558    1.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0704    0.6195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558    1.8573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4979    1.8560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558   -0.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558   -1.4467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0689   -1.8573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7854   -0.6235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0735   -0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5000   -0.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2146   -0.6235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
  1 11  1  0
 11 12  1  0
 11 13  2  0
  7 14  1  0
 15  6  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 15 20  1  0
 20 19  2  0
 19 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5219070

    ---

Associated Targets(Human)

PI4K2A Tbio PI4-kinase type II (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 295.30Molecular Weight (Monoisotopic): 295.1069AlogP: 0.87#Rotatable Bonds: 3
Polar Surface Area: 128.01Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.63CX LogP: -0.30CX LogD: -0.30
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.66Np Likeness Score: -0.38

References

1. Misehe M, Klima M, Matoušová M, Chalupská D, Dejmek M, Šála M, Mertlíková-Kaiserová H, Boura E, Nencka R..  (2022)  Structure-based design and modular synthesis of novel PI4K class II inhibitors bearing a 4-aminoquinazoline scaffold.,  76  [PMID:36184029] [10.1016/j.bmcl.2022.129010]

Source