The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,3-Dihydroxy-2-hydroxymethyl-6-methoxy-9,10-anthraquinone-3-O-beta-D-glucoside ID: ALA5219224
PubChem CID: 166177045
Max Phase: Preclinical
Molecular Formula: C22H22O11
Molecular Weight: 462.41
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)C(=O)c1cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(CO)c(O)c1C2=O
Standard InChI: InChI=1S/C22H22O11/c1-31-8-2-3-9-10(4-8)16(25)11-5-13(12(6-23)18(27)15(11)17(9)26)32-22-21(30)20(29)19(28)14(7-24)33-22/h2-5,14,19-24,27-30H,6-7H2,1H3/t14-,19-,20+,21-,22-/m1/s1
Standard InChI Key: UTMAXIKQMRKLOV-UACIBIBWSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-3.5709 0.4074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 0.8200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 1.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 2.0605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4302 1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7159 2.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7159 2.8861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0014 1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7110 2.0594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7110 2.8844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4257 1.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1402 2.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 0.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7160 0.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0014 0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7159 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4302 0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1403 0.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7159 -0.4137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1420 0.4136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1420 -0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 -0.8237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 -1.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1420 -2.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 -1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5709 -0.4112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5709 -2.0612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1420 -2.8861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -2.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -2.8861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8546 1.6470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5709 -0.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
5 6 1 0
6 7 2 0
8 6 1 0
8 9 1 0
9 10 1 0
11 9 2 0
11 12 1 0
13 11 1 0
14 13 2 0
15 14 1 0
15 8 2 0
16 15 1 0
17 16 1 0
17 5 2 0
18 17 1 0
2 18 2 0
16 19 2 0
13 20 1 0
21 20 1 1
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 21 1 0
26 27 1 6
25 28 1 1
24 29 1 6
23 30 1 1
30 31 1 0
12 32 1 0
1 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.41Molecular Weight (Monoisotopic): 462.1162AlogP: -1.15#Rotatable Bonds: 5Polar Surface Area: 183.21Molecular Species: NEUTRALHBA: 11HBD: 6#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.52CX Basic pKa: ┄CX LogP: -0.23CX LogD: -0.26Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.27Np Likeness Score: 1.80
References 1. Zhang Z, Shang ZP, Jiang Y, Qu ZX, Yang RY, Zhang J, Lin YX, Zhao F.. (2022) Selective Inhibition of PTP1B by New Anthraquinone Glycosides from Knoxia valerianoides ., 85 (12.0): [PMID:36399709 ] [10.1021/acs.jnatprod.2c00879 ]