8-cyclopentyl-2-[4-(4-ethylpiperazin-1-yl)anilino]-6-(2-furyl)pteridin-7-one

ID: ALA5219478

PubChem CID: 168299552

Max Phase: Preclinical

Molecular Formula: C27H31N7O2

Molecular Weight: 485.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN1CCN(c2ccc(Nc3ncc4nc(-c5ccco5)c(=O)n(C5CCCC5)c4n3)cc2)CC1

Standard InChI:  InChI=1S/C27H31N7O2/c1-2-32-13-15-33(16-14-32)20-11-9-19(10-12-20)29-27-28-18-22-25(31-27)34(21-6-3-4-7-21)26(35)24(30-22)23-8-5-17-36-23/h5,8-12,17-18,21H,2-4,6-7,13-16H2,1H3,(H,28,29,31)

Standard InChI Key:  QYSFRTVPLXILIJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   -1.7216    3.0115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0071    3.4238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2952    3.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2952    2.1867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0053    1.7750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7216    2.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4194    3.4245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1340    3.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1340    2.1867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4194    1.7741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8486    1.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8486    3.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4194    0.9489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0866    0.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8317   -0.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0069   -0.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2478    0.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4363    1.7704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4363    0.9453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7217    0.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7225   -0.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4373   -0.7029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1492   -0.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1540    0.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4373   -1.5281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7228   -1.9407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7228   -2.7659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4373   -3.1784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1520   -2.7659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1520   -1.9407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4373   -4.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7228   -4.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9348    4.2447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7417    4.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1540    3.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6021    3.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  9 11  2  0
  8 12  1  0
 10 13  1  0
 14 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  6 18  1  0
 18 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 22 25  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 25 30  1  0
 28 31  1  0
 31 32  1  0
 33 12  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 12  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5219478

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4/cyclin D1 (2340 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CCND1 Tchem CDK6/cyclin D1 (322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.59Molecular Weight (Monoisotopic): 485.2539AlogP: 4.45#Rotatable Bonds: 6
Polar Surface Area: 92.32Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.23CX LogP: 4.27CX LogD: 3.38
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.43Np Likeness Score: -1.50

References

1. He H, Liu Q, Chen L, Wang J, Yuan Y, Li H, Qian X, Zhao Z, Chen Z..  (2022)  Design, synthesis and biological evaluation of pteridine-7(8H)-one derivatives as potent and selective CDK4/6 inhibitors.,  76  [PMID:36130661] [10.1016/j.bmcl.2022.128991]

Source