The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[7-(diethylamino)-2-imino-chromen-3-yl]-6-(4-phenylpiperazin-1-yl)-1,3,5-triazin-2-amine ID: ALA5219557
PubChem CID: 168298850
Max Phase: Preclinical
Molecular Formula: C26H30N8O
Molecular Weight: 470.58
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)c1ccc2cc(-c3nc(N)nc(N4CCN(c5ccccc5)CC4)n3)c(=N)oc2c1
Standard InChI: InChI=1S/C26H30N8O/c1-3-32(4-2)20-11-10-18-16-21(23(27)35-22(18)17-20)24-29-25(28)31-26(30-24)34-14-12-33(13-15-34)19-8-6-5-7-9-19/h5-11,16-17,27H,3-4,12-15H2,1-2H3,(H2,28,29,30,31)
Standard InChI Key: VZDQERSWDNKZPU-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
0.0005 1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0005 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7139 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7150 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4295 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1440 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4295 1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7150 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7150 2.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8586 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5733 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5732 -0.8252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8585 -1.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1439 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2879 -1.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0028 -0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7149 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7149 -2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0046 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2879 -2.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7138 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4285 -1.2378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1431 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1432 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4286 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8559 -1.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5709 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5727 -0.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8610 0.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0008 -1.2378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2855 -1.2363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2855 -2.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0002 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7149 -1.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0002 -2.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
4 5 1 0
5 6 1 0
5 7 2 0
7 8 1 0
8 1 2 0
8 9 1 0
10 6 1 0
11 10 1 0
12 11 1 0
13 12 1 0
14 13 1 0
6 14 1 0
12 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
21 3 1 0
22 21 1 0
23 22 1 0
24 23 2 0
25 24 1 0
3 25 2 0
23 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
21 30 2 0
27 31 1 0
31 32 1 0
31 33 1 0
33 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.58Molecular Weight (Monoisotopic): 470.2543AlogP: 3.52#Rotatable Bonds: 6Polar Surface Area: 111.40Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.49CX LogP: 5.48CX LogD: 5.47Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.44Np Likeness Score: -1.11
References 1. Shahari MSB, Dolzhenko AV.. (2022) A closer look at N2 ,6-substituted 1,3,5-triazine-2,4-diamines: Advances in synthesis and biological activities., 241 [PMID:35981459 ] [10.1016/j.ejmech.2022.114645 ]