3-[2-Fluoro-4-methyl-5-(2-methylphenoxy)phenyl]-6-(trifluoromethyl)pyrimidine-2,4(1H,3H)-dione

ID: ALA5219636

PubChem CID: 156716041

Max Phase: Preclinical

Molecular Formula: C19H14F4N2O3

Molecular Weight: 394.32

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccccc1Oc1cc(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)c(F)cc1C

Standard InChI:  InChI=1S/C19H14F4N2O3/c1-10-5-3-4-6-14(10)28-15-8-13(12(20)7-11(15)2)25-17(26)9-16(19(21,22)23)24-18(25)27/h3-9H,1-2H3,(H,24,27)

Standard InChI Key:  WLUPQTKPKBLULM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   -1.7837   -1.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0693   -0.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3547   -1.0299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3547   -1.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0693   -2.2674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7837   -1.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3594   -2.2673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3594   -0.6174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3595    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0721    0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7866    0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7882   -0.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0767   -1.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0721    1.4424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7864    1.8548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7866    2.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4991    3.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136    2.6777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2152    1.8569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5038    1.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0693    0.2073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0724    3.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0767   -1.8564    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4979   -2.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4981   -3.0920    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2152   -1.8531    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2121   -2.6796    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5008    0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  2  0
  6  5  1  0
  4  7  2  0
  3  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 10 14  1  0
 14 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
  2 21  2  0
 16 22  1  0
 13 23  1  0
  6 24  1  0
 25 24  1  0
 24 26  1  0
 24 27  1  0
 11 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5219636

    ---

Associated Targets(Human)

BCAT1 Tchem Branched-chain-amino-acid transferase (80 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BCAT2 Tchem Branched-chain-amino-acid aminotransferase, mitochondrial (199 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 394.32Molecular Weight (Monoisotopic): 394.0941AlogP: 4.09#Rotatable Bonds: 3
Polar Surface Area: 64.09Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.04CX Basic pKa: CX LogP: 4.50CX LogD: 4.49
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.68Np Likeness Score: -0.93

References

1. Günther J, Hillig RC, Zimmermann K, Kaulfuss S, Lemos C, Nguyen D, Rehwinkel H, Habgood M, Lechner C, Neuhaus R, Ganzer U, Drewes M, Chai J, Bouché L..  (2022)  BAY-069, a Novel (Trifluoromethyl)pyrimidinedione-Based BCAT1/2 Inhibitor and Chemical Probe.,  65  (21.0): [PMID:36261130] [10.1021/acs.jmedchem.2c00441]
2. Bertrand, Sophie M SM and 31 more authors.  2015-09-24  The Discovery of in Vivo Active Mitochondrial Branched-Chain Aminotransferase (BCATm) Inhibitors by Hybridizing Fragment and HTS Hits.  [PMID:26090771]

Source