The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[2,6-Dioxo-4-(pentafluoroethyl)-3,6-dihydropyrimidin-1(2H)-yl]-5-methoxy-2-(2-methylphenoxy)benzonitrile ID: ALA5219673
PubChem CID: 156716035
Max Phase: Preclinical
Molecular Formula: C21H14F5N3O4
Molecular Weight: 467.35
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C#N)c(Oc2ccccc2C)cc1-n1c(=O)cc(C(F)(F)C(F)(F)F)[nH]c1=O
Standard InChI: InChI=1S/C21H14F5N3O4/c1-11-5-3-4-6-14(11)33-15-8-13(16(32-2)7-12(15)10-27)29-18(30)9-17(28-19(29)31)20(22,23)21(24,25)26/h3-9H,1-2H3,(H,28,31)
Standard InChI Key: QPQFNJFXGFRYKV-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
-1.7440 -0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0296 -0.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3150 -0.6175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3150 -1.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0296 -1.8551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7440 -1.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4585 -1.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4585 -2.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3992 -1.8551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3992 -0.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3992 0.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1119 1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8264 0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8280 -0.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1164 -0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5407 1.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2551 1.4424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1119 1.8548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8262 2.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8264 3.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5389 3.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2535 3.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2551 2.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5436 1.8531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0296 0.6196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1122 3.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1164 -1.4440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8307 -1.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1727 -3.0921 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.7443 -3.0921 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.4585 -3.5045 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.2551 -2.0685 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8708 -1.1408 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 2 0
6 5 1 0
6 7 1 0
7 8 1 0
4 9 2 0
3 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
13 16 1 0
16 17 3 0
12 18 1 0
18 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
2 25 2 0
20 26 1 0
15 27 1 0
27 28 1 0
8 29 1 0
8 30 1 0
8 31 1 0
7 32 1 0
7 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.35Molecular Weight (Monoisotopic): 467.0904AlogP: 4.16#Rotatable Bonds: 5Polar Surface Area: 97.11Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.30CX Basic pKa: ┄CX LogP: 4.24CX LogD: 4.23Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.57Np Likeness Score: -0.96
References 1. Günther J, Hillig RC, Zimmermann K, Kaulfuss S, Lemos C, Nguyen D, Rehwinkel H, Habgood M, Lechner C, Neuhaus R, Ganzer U, Drewes M, Chai J, Bouché L.. (2022) BAY-069, a Novel (Trifluoromethyl)pyrimidinedione-Based BCAT1/2 Inhibitor and Chemical Probe., 65 (21.0): [PMID:36261130 ] [10.1021/acs.jmedchem.2c00441 ] 2. Bertrand, Sophie M SM and 31 more authors. 2015-09-24 The Discovery of in Vivo Active Mitochondrial Branched-Chain Aminotransferase (BCATm) Inhibitors by Hybridizing Fragment and HTS Hits. [PMID:26090771 ]