(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[4-[(2Z)-2-[[4-(dimethylamino)phenyl]methylene]hydrazino]phenyl]methylamino]propanoic acid

ID: ALA5219909

PubChem CID: 168299835

Max Phase: Preclinical

Molecular Formula: C29H35Cl2N5O2

Molecular Weight: 556.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(/C=N\Nc2ccc(CN[C@@H](Cc3ccc(N(CCCl)CCCl)cc3)C(=O)O)cc2)cc1

Standard InChI:  InChI=1S/C29H35Cl2N5O2/c1-35(2)26-11-7-24(8-12-26)21-33-34-25-9-3-23(4-10-25)20-32-28(29(37)38)19-22-5-13-27(14-6-22)36(17-15-30)18-16-31/h3-14,21,28,32,34H,15-20H2,1-2H3,(H,37,38)/b33-21-/t28-/m0/s1

Standard InChI Key:  BACKHDGUPPTUNZ-QPSGIHIHSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
    0.0143    0.6056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0065    1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7173    1.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7098    2.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0083    3.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0150    3.9032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6958    4.3223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4112    3.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4236    3.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6884    5.1473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0298    5.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0374    6.3783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7555    6.7843    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.3991    5.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3915    6.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1023    6.8103    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.7114    1.8365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7191    2.6615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4222    1.4173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7328    0.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7405   -0.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4589   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4659   -1.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7549   -2.2736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0392   -1.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0267   -1.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7549   -3.0988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4696   -3.5114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4696   -4.3366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7549   -4.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7547   -5.5745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0418   -5.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6729   -5.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6745   -4.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0372   -4.3348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3876   -5.9850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3876   -6.8103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1023   -5.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  3  4  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
  4  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 10 14  1  0
 14 15  1  0
 15 16  1  0
  2 17  1  0
 17 18  1  0
 17 19  2  0
  1 20  1  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
 24 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 30 35  1  0
 33 36  1  0
 36 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5219909

    ---

Associated Targets(non-human)

CCRF S-180 (1031 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.54Molecular Weight (Monoisotopic): 555.2168AlogP: 5.27#Rotatable Bonds: 15
Polar Surface Area: 80.20Molecular Species: ZWITTERIONHBA: 6HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.04CX Basic pKa: 9.70CX LogP: 4.08CX LogD: 4.02
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.13Np Likeness Score: -0.91

References

1. Pahwa R, Chhabra J, Kumar R, Narang R..  (2022)  Melphalan: Recent insights on synthetic, analytical and medicinal aspects.,  238  [PMID:35665692] [10.1016/j.ejmech.2022.114494]

Source