The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-((2-((3-chloro-2-fluorobenzyl)amino)-2-oxoethyl)(cyclopropyl)amino)-2-oxoethyl)-5-hydroxy-1H-indazole-3-carboxamide ID: ALA5219944
PubChem CID: 130299838
Max Phase: Preclinical
Molecular Formula: C22H21ClFN5O4
Molecular Weight: 473.89
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1nn(CC(=O)N(CC(=O)NCc2cccc(Cl)c2F)C2CC2)c2ccc(O)cc12
Standard InChI: InChI=1S/C22H21ClFN5O4/c23-16-3-1-2-12(20(16)24)9-26-18(31)10-28(13-4-5-13)19(32)11-29-17-7-6-14(30)8-15(17)21(27-29)22(25)33/h1-3,6-8,13,30H,4-5,9-11H2,(H2,25,33)(H,26,31)
Standard InChI Key: WCRNTENIQWCMOY-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-4.6989 0.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1197 1.5773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3240 1.3696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1044 0.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6795 -0.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4786 0.1913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2950 -0.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4806 -0.6006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3593 0.1913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6477 0.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9300 0.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2185 0.6198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4991 0.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2105 0.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9282 0.2230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6399 0.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3576 0.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0693 0.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7844 0.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7905 -0.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0833 -0.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3636 -0.5951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4960 0.6622 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.0632 1.4763 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2045 1.4555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9239 -0.6232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7024 -1.4494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2846 -2.1609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5275 -1.4555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2185 1.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1948 2.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6302 2.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4960 1.2035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
7 8 2 0
9 8 1 0
4 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
19 23 1 0
18 24 1 0
14 25 2 0
11 26 2 0
7 27 1 0
27 28 2 0
27 29 1 0
30 12 1 0
30 31 1 0
30 32 1 0
31 32 1 0
1 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.89Molecular Weight (Monoisotopic): 473.1266AlogP: 1.94#Rotatable Bonds: 8Polar Surface Area: 130.55Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.38CX Basic pKa: ┄CX LogP: 1.30CX LogD: 1.30Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: -1.79
References 1. Zhang W, Wu M, Vadlakonda S, Juarez L, Cheng X, Muppa S, Chintareddy V, Vogeti L, Kellogg-Yelder D, Williams J, Polach K, Chen X, Raman K, Babu YS, Kotian P.. (2022) Scaffold hopping via ring opening enables identification of acyclic compounds as new complement Factor D inhibitors., 74 [PMID:36272185 ] [10.1016/j.bmc.2022.117034 ]