1-(2-((2-((3-chloro-2-fluorobenzyl)amino)-2-oxoethyl)(cyclopropyl)amino)-2-oxoethyl)-5-hydroxy-1H-indazole-3-carboxamide

ID: ALA5219944

PubChem CID: 130299838

Max Phase: Preclinical

Molecular Formula: C22H21ClFN5O4

Molecular Weight: 473.89

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)c1nn(CC(=O)N(CC(=O)NCc2cccc(Cl)c2F)C2CC2)c2ccc(O)cc12

Standard InChI:  InChI=1S/C22H21ClFN5O4/c23-16-3-1-2-12(20(16)24)9-26-18(31)10-28(13-4-5-13)19(32)11-29-17-7-6-14(30)8-15(17)21(27-29)22(25)33/h1-3,6-8,13,30H,4-5,9-11H2,(H2,25,33)(H,26,31)

Standard InChI Key:  WCRNTENIQWCMOY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -4.6989    0.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1197    1.5773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3240    1.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1044    0.5741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6795   -0.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4786    0.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2950   -0.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4806   -0.6006    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3593    0.1913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6477    0.6092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9300    0.2019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2185    0.6198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4991    0.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2105    0.6302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9282    0.2230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6399    0.6408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3576    0.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0693    0.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7844    0.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7905   -0.5809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0833   -0.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3636   -0.5951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4960    0.6622    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.0632    1.4763    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2045    1.4555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9239   -0.6232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7024   -1.4494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2846   -2.1609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5275   -1.4555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2185    1.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1948    2.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6302    2.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4960    1.2035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  9  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 19 23  1  0
 18 24  1  0
 14 25  2  0
 11 26  2  0
  7 27  1  0
 27 28  2  0
 27 29  1  0
 30 12  1  0
 30 31  1  0
 30 32  1  0
 31 32  1  0
  1 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5219944

    ---

Associated Targets(Human)

CFD Tchem Complement factor D (1353 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.89Molecular Weight (Monoisotopic): 473.1266AlogP: 1.94#Rotatable Bonds: 8
Polar Surface Area: 130.55Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.38CX Basic pKa: CX LogP: 1.30CX LogD: 1.30
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: -1.79

References

1. Zhang W, Wu M, Vadlakonda S, Juarez L, Cheng X, Muppa S, Chintareddy V, Vogeti L, Kellogg-Yelder D, Williams J, Polach K, Chen X, Raman K, Babu YS, Kotian P..  (2022)  Scaffold hopping via ring opening enables identification of acyclic compounds as new complement Factor D inhibitors.,  74  [PMID:36272185] [10.1016/j.bmc.2022.117034]

Source