The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3S)-2-(2-(hydroxy(methyl)amino)-4-oxo-3-thioxocyclobut-1-enylamino)-3-methyl-N-((S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl)pentanamide ID: ALA5220101
PubChem CID: 11711713
Max Phase: Preclinical
Molecular Formula: C21H28N4O4S
Molecular Weight: 432.55
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](Nc1c(N(C)O)c(=S)c1=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)NC
Standard InChI: InChI=1S/C21H28N4O4S/c1-5-12(2)15(24-16-17(25(4)29)19(30)18(16)26)21(28)23-14(20(27)22-3)11-13-9-7-6-8-10-13/h6-10,12,14-15,24,29H,5,11H2,1-4H3,(H,22,27)(H,23,28)/t12-,14-,15-/m0/s1
Standard InChI Key: VWOPOYQMVVOTAG-QEJZJMRPSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
-3.2787 -0.2057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5641 0.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5641 1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7253 1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7253 0.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0111 -0.2054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1475 1.6151 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.2965 0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4209 -0.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9932 0.2067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2787 -1.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1353 0.2050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4209 -1.0323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8498 -0.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5642 0.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8498 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5642 -1.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5642 1.0301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2787 -0.2073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9932 0.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2789 -1.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9908 -1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9908 -2.2697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2807 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5642 -2.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2965 1.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4338 1.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2403 1.6991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0026 1.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0026 2.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
4 5 1 0
2 5 2 0
5 6 1 0
3 7 2 0
6 8 1 0
8 9 1 1
1 10 1 0
1 11 1 0
9 12 1 0
9 13 2 0
12 14 1 0
14 15 1 0
14 16 1 6
16 17 1 0
15 18 2 0
15 19 1 0
19 20 1 0
21 17 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
17 25 1 0
8 26 1 0
26 27 1 6
4 28 2 0
26 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.55Molecular Weight (Monoisotopic): 432.1831AlogP: 1.78#Rotatable Bonds: 10Polar Surface Area: 110.77Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.57CX Basic pKa: ┄CX LogP: 1.78CX LogD: 1.78Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.33Np Likeness Score: -0.30