Ethyl 2-(5-(4-Chlorophenyl)furan-2-yl)-4-hydroxy-1-(6-methylbenzo[d]thiazol-2-yl)-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5220137

PubChem CID: 124222222

Max Phase: Preclinical

Molecular Formula: C25H19ClN2O5S

Molecular Weight: 494.96

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(c2nc3ccc(C)cc3s2)C1c1ccc(-c2ccc(Cl)cc2)o1

Standard InChI:  InChI=1S/C25H19ClN2O5S/c1-3-32-24(31)20-21(18-11-10-17(33-18)14-5-7-15(26)8-6-14)28(23(30)22(20)29)25-27-16-9-4-13(2)12-19(16)34-25/h4-12,21,29H,3H2,1-2H3

Standard InChI Key:  NBZPOMWJBSLLCT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    2.1600    0.6613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9464    1.4582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5298    2.0415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3267    1.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9100    2.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1496    1.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4959    1.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1716    1.6929    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9685    1.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0742    2.4759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8994    2.4759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3119    3.1904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3383    3.1904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4959    0.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2103   -0.0365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0250   -0.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2237   -0.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1083   -0.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6083   -1.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4053   -1.2278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9863   -1.8100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7727   -2.6071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9803   -2.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3938   -2.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3561   -3.1904    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.1820    0.6826    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0234    0.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3089    1.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6609    1.9195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5316    0.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3267    0.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6125    0.9053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1071    1.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9100   -0.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  6  2  1  0
  6  7  1  0
  8  7  1  0
  8  9  1  0
 10  8  1  0
 10 11  1  0
 11  6  2  0
 11 12  1  0
 10 13  2  0
 14  7  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 18 17  1  0
 14 18  2  0
 19 16  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 19 24  1  0
 24 23  2  0
 22 25  1  0
 26  9  1  0
 26 27  1  0
 27 28  2  0
 29 28  1  0
  9 29  2  0
 27 30  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 28 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220137

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.96Molecular Weight (Monoisotopic): 494.0703AlogP: 5.98#Rotatable Bonds: 5
Polar Surface Area: 92.87Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.62CX Basic pKa: CX LogP: 5.46CX LogD: 5.26
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.63

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source