The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[[1-(7-methoxy-2-oxo-chromen-3-yl)triazol-4-yl]methoxy]-2-(2-pyridyl)thiazole-5-carboxamide ID: ALA5220158
PubChem CID: 168299315
Max Phase: Preclinical
Molecular Formula: C22H16N6O5S
Molecular Weight: 476.47
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2cc(-n3cc(COc4nc(-c5ccccn5)sc4C(N)=O)nn3)c(=O)oc2c1
Standard InChI: InChI=1S/C22H16N6O5S/c1-31-14-6-5-12-8-16(22(30)33-17(12)9-14)28-10-13(26-27-28)11-32-20-18(19(23)29)34-21(25-20)15-4-2-3-7-24-15/h2-10H,11H2,1H3,(H2,23,29)
Standard InChI Key: BBEMZDCANZHGAH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.4626 -1.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4626 -1.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7482 -0.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0337 -1.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3192 -0.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6048 -1.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3192 -2.3450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0337 -1.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7482 -2.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6048 -1.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8901 -2.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8901 -0.6949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1366 -1.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4153 -0.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0028 0.2968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8039 0.1253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2405 -0.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6532 0.2972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4784 0.2972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9632 -0.3700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7477 -0.1151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7477 0.7096 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.9632 0.9644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7496 1.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3332 2.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9525 1.9752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1773 -2.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8921 -1.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4624 -0.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4626 -1.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1756 -1.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8904 -1.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8921 -0.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1802 -0.1134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
8 7 1 0
4 8 2 0
8 9 1 0
1 9 2 0
6 10 1 0
10 7 1 0
10 11 2 0
6 12 1 0
13 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 12 1 0
14 17 1 0
17 18 1 0
18 19 1 0
20 19 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 19 2 0
23 24 1 0
24 25 2 0
24 26 1 0
1 27 1 0
27 28 1 0
21 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.47Molecular Weight (Monoisotopic): 476.0903AlogP: 2.58#Rotatable Bonds: 7Polar Surface Area: 148.25Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.31CX Basic pKa: 0.29CX LogP: 2.46CX LogD: 2.46Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -1.38