Ethyl 4-Hydroxy-2-(4-hydroxyphenyl)-1-(6-methylbenzo[d]thiazol-2-yl)-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5220194

PubChem CID: 168299712

Max Phase: Preclinical

Molecular Formula: C21H18N2O5S

Molecular Weight: 410.45

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(c2nc3ccc(C)cc3s2)C1c1ccc(O)cc1

Standard InChI:  InChI=1S/C21H18N2O5S/c1-3-28-20(27)16-17(12-5-7-13(24)8-6-12)23(19(26)18(16)25)21-22-14-9-4-11(2)10-15(14)29-21/h4-10,17,24-25H,3H2,1-2H3

Standard InChI Key:  YNCBTGQNFWOEEK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    0.0741    1.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8991    1.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1492    1.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4957    0.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1716    1.1458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9682    0.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9458    0.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5290    1.4943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1593    0.1145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3115    2.6428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3382    2.6428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3257    1.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9088    1.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4957   -0.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2099   -0.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2091   -1.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4947   -1.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2167   -1.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2215   -0.5849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4947   -2.6428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1817    0.1357    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0227    0.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3081    0.8551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6604    1.3723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5308   -0.5189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3257   -0.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6113    0.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1062    0.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9088   -0.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  4  1  0
  1  5  1  0
  5  6  1  0
  3  7  1  0
  7  8  1  0
  7  9  2  0
  2 10  1  0
  1 11  2  0
  8 12  1  0
 12 13  1  0
 14  4  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 14 19  1  0
 19 18  2  0
 17 20  1  0
 21  6  1  0
 21 22  1  0
 22 23  2  0
 24 23  1  0
  6 24  2  0
 22 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220194

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.45Molecular Weight (Monoisotopic): 410.0936AlogP: 3.77#Rotatable Bonds: 4
Polar Surface Area: 99.96Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.69CX Basic pKa: CX LogP: 3.93CX LogD: 3.75
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.64Np Likeness Score: -1.43

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source