6-acetyl-8-cyclopentyl-2-[4-(4-cyclopentylpiperazin-1-yl)anilino]pteridin-7-one

ID: ALA5220201

PubChem CID: 168299857

Max Phase: Preclinical

Molecular Formula: C28H35N7O2

Molecular Weight: 501.64

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)c1nc2cnc(Nc3ccc(N4CCN(C5CCCC5)CC4)cc3)nc2n(C2CCCC2)c1=O

Standard InChI:  InChI=1S/C28H35N7O2/c1-19(36)25-27(37)35(23-8-4-5-9-23)26-24(31-25)18-29-28(32-26)30-20-10-12-22(13-11-20)34-16-14-33(15-17-34)21-6-2-3-7-21/h10-13,18,21,23H,2-9,14-17H2,1H3,(H,29,30,32)

Standard InChI Key:  ZNTIUNUWTBBLGR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   -1.4263    3.5231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7117    3.9354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    3.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    2.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7099    2.2865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263    2.6946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    3.9361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4294    3.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4294    2.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    2.2857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    2.2857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    3.9361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    4.7613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8587    3.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    1.4605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3820    0.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1271    0.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3023    0.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0474    0.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1409    2.2820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1409    1.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263    1.0440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4271    0.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -0.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8538    0.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8587    1.0424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -1.0165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4274   -1.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4274   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -2.6669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8566   -2.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8566   -1.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -3.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4747   -3.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7296   -4.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5544   -4.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8093   -3.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  9 11  2  0
  8 12  1  0
 12 13  2  0
 12 14  1  0
 10 15  1  0
 16 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
  6 20  1  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
 24 27  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 27 32  1  0
 30 33  1  0
 34 33  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220201

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4/cyclin D1 (2340 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CCND1 Tchem CDK6/cyclin D1 (322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.64Molecular Weight (Monoisotopic): 501.2852AlogP: 4.31#Rotatable Bonds: 6
Polar Surface Area: 96.25Molecular Species: BASEHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.95CX LogP: 4.84CX LogD: 3.28
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.50Np Likeness Score: -1.12

References

1. He H, Liu Q, Chen L, Wang J, Yuan Y, Li H, Qian X, Zhao Z, Chen Z..  (2022)  Design, synthesis and biological evaluation of pteridine-7(8H)-one derivatives as potent and selective CDK4/6 inhibitors.,  76  [PMID:36130661] [10.1016/j.bmcl.2022.128991]

Source