(2S)-2-[[2-[2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid

ID: ALA5220282

PubChem CID: 148939803

Max Phase: Preclinical

Molecular Formula: C27H39Cl2N5O11

Molecular Weight: 680.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O

Standard InChI:  InChI=1S/C27H39Cl2N5O11/c28-5-7-34(8-6-29)20-3-1-19(2-4-20)13-21(27(44)45)30-22(35)14-32(16-24(38)39)11-9-31(15-23(36)37)10-12-33(17-25(40)41)18-26(42)43/h1-4,21H,5-18H2,(H,30,35)(H,36,37)(H,38,39)(H,40,41)(H,42,43)(H,44,45)/t21-/m0/s1

Standard InChI Key:  PNRGCNWKVCKRJB-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 45 45  0  0  0  0  0  0  0  0999 V2000
   -2.3322    0.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5457    1.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9624    1.9636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1759    2.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5925    3.3438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7957    3.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9728    2.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1863    3.7708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5561    2.3906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2121    3.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5821    3.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7957    2.7027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2163    2.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5812    2.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5925    2.4892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1759    3.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9728    2.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5561    3.4424    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.8061    1.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6030    1.4788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8165    0.6820    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.3426    1.5937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5353    0.3698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3218   -0.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9520    0.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1551    0.7396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4282    1.3230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0584   -0.0572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9051   -1.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6916   -1.8073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2750   -2.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8947   -2.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0614   -3.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6448   -3.7708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2646   -3.4010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -1.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4854   -1.6510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0687   -1.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6989   -2.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4958   -2.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7093   -3.4582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0791   -2.0779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8553   -0.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4385    0.3126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2719    0.3126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  6
  4  5  1  0
  5  6  1  0
  4  7  1  0
  7  8  1  0
  7  9  2  0
 10  6  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  6 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 15 19  1  0
 19 20  1  0
 20 21  1  0
  2 22  2  0
  1 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  2  0
 26 28  1  0
 24 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  1  0
 31 33  1  0
 33 34  2  0
 33 35  1  0
 32 36  1  0
 36 37  1  0
 37 38  1  0
 37 39  1  0
 39 40  1  0
 40 41  1  0
 40 42  2  0
 38 43  1  0
 43 44  2  0
 43 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220282

    ---

Associated Targets(non-human)

CCRF S-180 (1031 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 680.54Molecular Weight (Monoisotopic): 679.2023AlogP: -0.67#Rotatable Bonds: 25
Polar Surface Area: 228.56Molecular Species: ZWITTERIONHBA: 10HBD: 6
#RO5 Violations: 2HBA (Lipinski): 16HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 0.61CX Basic pKa: 10.32CX LogP: -2.76CX LogD: -15.44
Aromatic Rings: 1Heavy Atoms: 45QED Weighted: 0.07Np Likeness Score: -0.45

References

1. Pahwa R, Chhabra J, Kumar R, Narang R..  (2022)  Melphalan: Recent insights on synthetic, analytical and medicinal aspects.,  238  [PMID:35665692] [10.1016/j.ejmech.2022.114494]

Source