Ethyl 4-Hydroxy-2-(6-hydroxynaphthalen-2-yl)-1-(6-methylbenzo[d]thiazol-2-yl)-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5220350

PubChem CID: 168298250

Max Phase: Preclinical

Molecular Formula: C25H20N2O5S

Molecular Weight: 460.51

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(c2nc3ccc(C)cc3s2)C1c1ccc2cc(O)ccc2c1

Standard InChI:  InChI=1S/C25H20N2O5S/c1-3-32-24(31)20-21(16-6-5-15-12-17(28)8-7-14(15)11-16)27(23(30)22(20)29)25-26-18-9-4-13(2)10-19(18)33-25/h4-12,21,28-29H,3H2,1-2H3

Standard InChI Key:  LNAMWJUAWUDFFZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    0.0741    2.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8991    2.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1492    1.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4957    1.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1716    1.7640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9682    1.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4957    0.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2099    0.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2091   -0.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4947   -1.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2167   -0.7910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2215    0.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4949   -2.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2114   -2.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9213   -2.0242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9211   -1.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2114   -3.2609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9458    1.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5290    2.1125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3257    1.8990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9088    2.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1593    0.7326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3115    3.2609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3382    3.2609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1817    0.7539    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0227    0.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3081    1.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6604    1.9904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5308    0.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3257    0.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6113    0.9766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1062    1.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9088   -0.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  4  1  0
  1  5  1  0
  5  6  1  0
  7  4  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
  7 12  1  0
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
  9 16  1  0
 14 17  1  0
  3 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 18 22  2  0
  2 23  1  0
  1 24  2  0
 25  6  1  0
 25 26  1  0
 26 27  2  0
 28 27  1  0
  6 28  2  0
 26 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220350

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.51Molecular Weight (Monoisotopic): 460.1093AlogP: 4.93#Rotatable Bonds: 4
Polar Surface Area: 99.96Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.79CX Basic pKa: CX LogP: 4.92CX LogD: 4.77
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.18

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source