The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 4-Hydroxy-2-(6-hydroxynaphthalen-2-yl)-1-(6-methylbenzo[d]thiazol-2-yl)-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate ID: ALA5220350
PubChem CID: 168298250
Max Phase: Preclinical
Molecular Formula: C25H20N2O5S
Molecular Weight: 460.51
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(O)C(=O)N(c2nc3ccc(C)cc3s2)C1c1ccc2cc(O)ccc2c1
Standard InChI: InChI=1S/C25H20N2O5S/c1-3-32-24(31)20-21(16-6-5-15-12-17(28)8-7-14(15)11-16)27(23(30)22(20)29)25-26-18-9-4-13(2)10-19(18)33-25/h4-12,21,28-29H,3H2,1-2H3
Standard InChI Key: LNAMWJUAWUDFFZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
0.0741 2.5467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8991 2.5467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1492 1.7427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4957 1.2721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1716 1.7640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9682 1.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4957 0.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2099 0.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2091 -0.7874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4947 -1.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2167 -0.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2215 0.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4949 -2.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2114 -2.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9213 -2.0242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9211 -1.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2114 -3.2609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9458 1.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5290 2.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3257 1.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9088 2.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1593 0.7326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3115 3.2609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3382 3.2609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1817 0.7539 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.0227 0.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3081 1.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6604 1.9904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5308 0.0991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3257 0.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6113 0.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1062 1.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9088 -0.3549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
5 4 1 0
1 5 1 0
5 6 1 0
7 4 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
7 12 1 0
10 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
9 16 1 0
14 17 1 0
3 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
18 22 2 0
2 23 1 0
1 24 2 0
25 6 1 0
25 26 1 0
26 27 2 0
28 27 1 0
6 28 2 0
26 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
30 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.51Molecular Weight (Monoisotopic): 460.1093AlogP: 4.93#Rotatable Bonds: 4Polar Surface Area: 99.96Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.79CX Basic pKa: ┄CX LogP: 4.92CX LogD: 4.77Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.18
References 1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M.. (2022) Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA., 65 (21.0): [PMID:36269107 ] [10.1021/acs.jmedchem.2c01275 ]