Ethyl 4-Hydroxy-2-(4-methoxynaphthalen-1-yl)-1-(6-methylbenzo[d]thiazol-2-yl)-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5220379

PubChem CID: 168298380

Max Phase: Preclinical

Molecular Formula: C26H22N2O5S

Molecular Weight: 474.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(c2nc3ccc(C)cc3s2)C1c1ccc(OC)c2ccccc12

Standard InChI:  InChI=1S/C26H22N2O5S/c1-4-33-25(31)21-22(17-10-12-19(32-3)16-8-6-5-7-15(16)17)28(24(30)23(21)29)26-27-18-11-9-14(2)13-20(18)34-26/h5-13,22,29H,4H2,1-3H3

Standard InChI Key:  VNPWKZSVQMXKMQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    0.0742    2.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8992    2.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1493    1.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4958    0.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1716    1.3521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9683    1.1386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4958    0.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2100   -0.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2093   -1.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4947   -1.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2167   -1.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2215   -0.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4947   -2.4368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2091   -2.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9241   -1.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6337   -1.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6327   -0.3801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9206    0.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9460    1.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5293    1.7006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3260    1.4872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9092    2.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1595    0.3207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3116    2.8492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3382    2.8492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1817    0.3420    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0229    0.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3083    1.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6605    1.5786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5310   -0.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3260   -0.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6116    0.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1064    1.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9092   -0.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  4  1  0
  1  5  1  0
  5  6  1  0
  7  4  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
  7 12  1  0
 10 13  1  0
 13 14  1  0
  9 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
  8 18  1  0
  3 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 19 23  2  0
  2 24  1  0
  1 25  2  0
 26  6  1  0
 26 27  1  0
 27 28  2  0
 29 28  1  0
  6 29  2  0
 27 30  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 28 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220379

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.54Molecular Weight (Monoisotopic): 474.1249AlogP: 5.23#Rotatable Bonds: 5
Polar Surface Area: 88.96Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.87CX Basic pKa: CX LogP: 5.06CX LogD: 4.94
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -1.26

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source