The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 4-Hydroxy-2-(4-methoxynaphthalen-1-yl)-1-(6-methylbenzo[d]thiazol-2-yl)-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate ID: ALA5220379
PubChem CID: 168298380
Max Phase: Preclinical
Molecular Formula: C26H22N2O5S
Molecular Weight: 474.54
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(O)C(=O)N(c2nc3ccc(C)cc3s2)C1c1ccc(OC)c2ccccc12
Standard InChI: InChI=1S/C26H22N2O5S/c1-4-33-25(31)21-22(17-10-12-19(32-3)16-8-6-5-7-15(16)17)28(24(30)23(21)29)26-27-18-11-9-14(2)13-20(18)34-26/h5-13,22,29H,4H2,1-3H3
Standard InChI Key: VNPWKZSVQMXKMQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
0.0742 2.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8992 2.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1493 1.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4958 0.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1716 1.3521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9683 1.1386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4958 0.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2100 -0.3771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2093 -1.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4947 -1.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2167 -1.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2215 -0.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4947 -2.4368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2091 -2.8492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9241 -1.6128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6337 -1.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6327 -0.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9206 0.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9460 1.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5293 1.7006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3260 1.4872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9092 2.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1595 0.3207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3116 2.8492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3382 2.8492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1817 0.3420 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.0229 0.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3083 1.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6605 1.5786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5310 -0.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3260 -0.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6116 0.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1064 1.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9092 -0.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
5 4 1 0
1 5 1 0
5 6 1 0
7 4 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
7 12 1 0
10 13 1 0
13 14 1 0
9 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
8 18 1 0
3 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
19 23 2 0
2 24 1 0
1 25 2 0
26 6 1 0
26 27 1 0
27 28 2 0
29 28 1 0
6 29 2 0
27 30 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
31 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.54Molecular Weight (Monoisotopic): 474.1249AlogP: 5.23#Rotatable Bonds: 5Polar Surface Area: 88.96Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.87CX Basic pKa: ┄CX LogP: 5.06CX LogD: 4.94Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -1.26
References 1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M.. (2022) Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA., 65 (21.0): [PMID:36269107 ] [10.1021/acs.jmedchem.2c01275 ]