Ethyl 2-([1,1'-biphenyl]-4-yl)-4-hydroxy-5-oxo-1-(6-(trifluoromethyl)benzo[d]thiazol-2-yl)-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5220390

PubChem CID: 168298506

Max Phase: Preclinical

Molecular Formula: C27H19F3N2O4S

Molecular Weight: 524.52

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(c2nc3ccc(C(F)(F)F)cc3s2)C1c1ccc(-c2ccccc2)cc1

Standard InChI:  InChI=1S/C27H19F3N2O4S/c1-2-36-25(35)21-22(17-10-8-16(9-11-17)15-6-4-3-5-7-15)32(24(34)23(21)33)26-31-19-13-12-18(27(28,29)30)14-20(19)37-26/h3-14,22,33H,2H2,1H3

Standard InChI Key:  KFUFYNSQVBTXNX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    0.4724    2.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2974    2.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5475    1.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8940    1.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2266    1.9695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5699    1.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7834    0.9594    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6244    0.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9098    1.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2621    2.1959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7078    1.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2130    1.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9274    0.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1325    0.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8940    0.6529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6082    0.2403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6074   -0.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8930   -0.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1815   -0.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1767    0.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8930   -1.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6071   -2.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6064   -3.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8919   -3.4664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1804   -3.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1757   -2.2332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3442    1.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9274    2.3180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7240    2.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3072    2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5577    0.9381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7098    3.4664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0601    3.4664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5105   -0.1494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2971   -0.9460    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3072    0.0640    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0937   -0.7326    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  4  1  0
  1  5  1  0
  6  5  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
 10  9  1  0
  6 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
  8 14  1  0
  4 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 21 18  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
  3 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 27 31  2  0
  2 32  1  0
  1 33  2  0
 13 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220390

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.52Molecular Weight (Monoisotopic): 524.1018AlogP: 6.45#Rotatable Bonds: 5
Polar Surface Area: 79.73Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.39CX Basic pKa: CX LogP: 6.24CX LogD: 5.93
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -1.45

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source