The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-((2-((3-chloro-2-fluorobenzyl)amino)-2-oxoethyl)(cyclopropyl)amino)-2-oxoethyl)-5-(4-cyclopropylpiperazine-1-carboxamido)-1H-indazole-3-carboxamide ID: ALA5220461
PubChem CID: 130300317
Max Phase: Preclinical
Molecular Formula: C30H34ClFN8O4
Molecular Weight: 625.10
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1nn(CC(=O)N(CC(=O)NCc2cccc(Cl)c2F)C2CC2)c2ccc(NC(=O)N3CCN(C4CC4)CC3)cc12
Standard InChI: InChI=1S/C30H34ClFN8O4/c31-23-3-1-2-18(27(23)32)15-34-25(41)16-39(21-7-8-21)26(42)17-40-24-9-4-19(14-22(24)28(36-40)29(33)43)35-30(44)38-12-10-37(11-13-38)20-5-6-20/h1-4,9,14,20-21H,5-8,10-13,15-17H2,(H2,33,43)(H,34,41)(H,35,44)
Standard InChI Key: ZHNLFMKNBJQZNY-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
-0.9997 -2.1604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4175 -1.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2424 -1.4549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0102 -0.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1960 -0.6005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0747 0.1913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6366 0.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3541 0.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3601 -0.6230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0655 0.6196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7829 0.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4943 0.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2117 0.2229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9231 0.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6406 0.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6468 -0.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3661 -0.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0732 -0.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0671 0.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7785 0.6621 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.3522 0.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3461 1.4759 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.4882 1.4549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0655 1.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4787 2.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6538 2.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8198 0.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3946 -0.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1934 0.1912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4138 0.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8347 1.5770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0391 1.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2105 1.2032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7940 0.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5804 -0.1769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5908 0.8333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1742 0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9710 0.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1845 1.2604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.6012 1.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8044 1.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9814 1.4739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5658 2.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7785 1.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
4 2 1 0
4 5 2 0
6 5 1 0
6 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
21 15 2 0
19 21 1 0
21 22 1 0
12 23 2 0
24 10 1 0
24 25 1 0
25 26 1 0
24 26 1 0
27 6 1 0
28 4 1 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
27 32 2 0
32 31 1 0
30 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
37 36 1 0
38 37 1 0
39 38 1 0
40 39 1 0
41 40 1 0
36 41 1 0
39 42 1 0
43 42 1 0
43 44 1 0
42 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 625.10Molecular Weight (Monoisotopic): 624.2376AlogP: 2.55#Rotatable Bonds: 10Polar Surface Area: 145.90Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.93CX Basic pKa: 7.06CX LogP: 1.27CX LogD: 1.11Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.32Np Likeness Score: -2.21
References 1. Zhang W, Wu M, Vadlakonda S, Juarez L, Cheng X, Muppa S, Chintareddy V, Vogeti L, Kellogg-Yelder D, Williams J, Polach K, Chen X, Raman K, Babu YS, Kotian P.. (2022) Scaffold hopping via ring opening enables identification of acyclic compounds as new complement Factor D inhibitors., 74 [PMID:36272185 ] [10.1016/j.bmc.2022.117034 ]