Ethyl 4-hydroxy-1-(naphtho[1,2-d]thiazol-2-yl)-5-oxo-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5220491

PubChem CID: 168298266

Max Phase: Preclinical

Molecular Formula: C24H18N2O4S

Molecular Weight: 430.49

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(c2nc3c(ccc4ccccc43)s2)C1c1ccccc1

Standard InChI:  InChI=1S/C24H18N2O4S/c1-2-30-23(29)18-20(15-9-4-3-5-10-15)26(22(28)21(18)27)24-25-19-16-11-7-6-8-14(16)12-13-17(19)31-24/h3-13,20,27H,2H2,1H3

Standard InChI Key:  QMNDYJPQBHYYET-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    0.2220    0.7376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4692    1.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0545    2.2428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2987    1.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7134    2.2428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5502    0.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8931    0.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8931   -0.5863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3513    0.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9377    1.0880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7388    0.8733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3252    1.4597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5659   -0.2994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5790    0.5229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7936   -0.2780    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6393   -0.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1502   -0.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9495   -0.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2367   -0.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7288    0.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9263    0.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2750    0.9653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0335    0.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3252    0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8212    1.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0216    1.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6113   -1.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6105   -1.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8920   -2.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1766   -1.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1718   -1.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  4  6  2  0
  1  7  1  0
  6  7  1  0
  7  8  1  0
  6  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  9 13  2  0
  1 14  1  0
 15 14  1  0
 15 16  1  0
 16 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 16 21  2  0
 21 20  1  0
 14 22  2  0
 22 21  1  0
 19 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 20 26  1  0
 27  8  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
  8 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220491

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.49Molecular Weight (Monoisotopic): 430.0987AlogP: 4.91#Rotatable Bonds: 4
Polar Surface Area: 79.73Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.90CX Basic pKa: CX LogP: 4.71CX LogD: 4.59
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.30

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source