The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-((2-((3-chloro-2-fluorobenzyl)amino)-2-oxoethyl)(cyclopropyl)amino)-2-oxoethyl)-5-(3,3-dimethylbutanamido)-1H-indazole-3-carboxamide ID: ALA5220542
PubChem CID: 130324829
Max Phase: Preclinical
Molecular Formula: C28H32ClFN6O4
Molecular Weight: 571.05
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)CC(=O)Nc1ccc2c(c1)c(C(N)=O)nn2CC(=O)N(CC(=O)NCc1cccc(Cl)c1F)C1CC1
Standard InChI: InChI=1S/C28H32ClFN6O4/c1-28(2,3)12-22(37)33-17-7-10-21-19(11-17)26(27(31)40)34-36(21)15-24(39)35(18-8-9-18)14-23(38)32-13-16-5-4-6-20(29)25(16)30/h4-7,10-11,18H,8-9,12-15H2,1-3H3,(H2,31,40)(H,32,38)(H,33,37)
Standard InChI Key: MELJYNUKCBXZHQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
5.4426 1.4760 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4487 0.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7371 0.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0195 0.6407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3082 0.2229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5907 0.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5846 1.4551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 0.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1617 0.6196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1617 1.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5750 2.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7501 2.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4504 0.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2671 0.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9785 0.1913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7236 0.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9430 1.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7386 1.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3177 0.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0974 0.1912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2984 -0.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9141 -0.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0998 -0.6005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3213 -1.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1463 -1.4551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9035 -2.1604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4564 -0.6230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7432 -0.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4627 -0.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1698 -0.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1637 0.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8751 0.6622 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.1146 1.2032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6978 0.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4948 0.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4844 -0.1770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.0782 0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8751 0.4636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8647 -0.5467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6616 -0.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
4 3 1 0
5 4 1 0
6 5 1 0
6 7 2 0
8 6 1 0
9 8 1 0
10 9 1 0
10 11 1 0
11 12 1 0
10 12 1 0
13 9 1 0
14 13 1 0
15 14 1 0
16 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
21 22 1 0
15 23 1 0
22 23 2 0
22 24 1 0
24 25 1 0
24 26 2 0
13 27 2 0
3 28 1 0
28 29 2 0
29 30 1 0
31 2 1 0
30 31 2 0
31 32 1 0
19 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
37 39 1 0
37 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 571.05Molecular Weight (Monoisotopic): 570.2158AlogP: 3.61#Rotatable Bonds: 10Polar Surface Area: 139.42Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.28CX Basic pKa: ┄CX LogP: 2.58CX LogD: 2.58Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.34Np Likeness Score: -2.12
References 1. Zhang W, Wu M, Vadlakonda S, Juarez L, Cheng X, Muppa S, Chintareddy V, Vogeti L, Kellogg-Yelder D, Williams J, Polach K, Chen X, Raman K, Babu YS, Kotian P.. (2022) Scaffold hopping via ring opening enables identification of acyclic compounds as new complement Factor D inhibitors., 74 [PMID:36272185 ] [10.1016/j.bmc.2022.117034 ]