The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Lucidin 11-O-beta-D-Glucoside ID: ALA5220593
PubChem CID: 168299872
Max Phase: Preclinical
Molecular Formula: C21H20O10
Molecular Weight: 432.38
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2ccccc2C(=O)c2c1cc(O)c(CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c2O
Standard InChI: InChI=1S/C21H20O10/c22-6-13-18(27)19(28)20(29)21(31-13)30-7-11-12(23)5-10-14(17(11)26)16(25)9-4-2-1-3-8(9)15(10)24/h1-5,13,18-23,26-29H,6-7H2/t13-,18-,19+,20-,21-/m1/s1
Standard InChI Key: ZPYJBMSCFWZBRZ-PTKNJCLRSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-4.1798 -0.1746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3703 -0.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8275 -0.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0942 -1.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9036 -1.5768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5512 -2.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7416 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4749 -1.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0177 -0.4768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6655 -0.9388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3988 -0.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4104 0.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6770 0.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1595 1.4244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4864 0.9414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7530 1.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2355 2.3645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5625 1.8816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8287 2.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6383 2.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1798 2.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9180 1.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1053 1.2604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8386 0.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0292 0.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7627 -0.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9532 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6556 -1.3893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3562 -0.1627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1987 -2.5004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8178 -2.8195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 1
3 4 1 0
4 5 1 6
4 6 1 0
6 7 1 0
7 8 1 0
3 9 1 0
8 9 1 0
8 10 1 1
10 11 1 0
11 12 1 0
13 12 2 0
13 14 1 0
15 13 1 0
15 16 1 0
16 17 2 0
18 16 1 0
18 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 18 2 0
23 22 1 0
24 23 1 0
25 15 2 0
25 24 1 0
26 25 1 0
27 26 2 0
12 27 1 0
27 28 1 0
24 29 2 0
7 30 1 6
6 31 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.38Molecular Weight (Monoisotopic): 432.1056AlogP: -0.81#Rotatable Bonds: 4Polar Surface Area: 173.98Molecular Species: NEUTRALHBA: 10HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.98CX Basic pKa: ┄CX LogP: 0.42CX LogD: -0.15Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: 1.80
References 1. Zhang Z, Shang ZP, Jiang Y, Qu ZX, Yang RY, Zhang J, Lin YX, Zhao F.. (2022) Selective Inhibition of PTP1B by New Anthraquinone Glycosides from Knoxia valerianoides ., 85 (12.0): [PMID:36399709 ] [10.1021/acs.jnatprod.2c00879 ]