Lucidin 11-O-beta-D-Glucoside

ID: ALA5220593

PubChem CID: 168299872

Max Phase: Preclinical

Molecular Formula: C21H20O10

Molecular Weight: 432.38

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1c2ccccc2C(=O)c2c1cc(O)c(CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c2O

Standard InChI:  InChI=1S/C21H20O10/c22-6-13-18(27)19(28)20(29)21(31-13)30-7-11-12(23)5-10-14(17(11)26)16(25)9-4-2-1-3-8(9)15(10)24/h1-5,13,18-23,26-29H,6-7H2/t13-,18-,19+,20-,21-/m1/s1

Standard InChI Key:  ZPYJBMSCFWZBRZ-PTKNJCLRSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -4.1798   -0.1746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3703   -0.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8275   -0.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0942   -1.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9036   -1.5768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5512   -2.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7416   -1.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4749   -1.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0177   -0.4768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6655   -0.9388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3988   -0.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4104    0.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6770    0.7820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1595    1.4244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4864    0.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7530    1.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2355    2.3645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5625    1.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8287    2.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6383    2.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1798    2.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9180    1.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1053    1.2604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8386    0.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0292    0.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7627   -0.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9532   -0.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6556   -1.3893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3562   -0.1627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1987   -2.5004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8178   -2.8195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  1
  3  4  1  0
  4  5  1  6
  4  6  1  0
  6  7  1  0
  7  8  1  0
  3  9  1  0
  8  9  1  0
  8 10  1  1
 10 11  1  0
 11 12  1  0
 13 12  2  0
 13 14  1  0
 15 13  1  0
 15 16  1  0
 16 17  2  0
 18 16  1  0
 18 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 18  2  0
 23 22  1  0
 24 23  1  0
 25 15  2  0
 25 24  1  0
 26 25  1  0
 27 26  2  0
 12 27  1  0
 27 28  1  0
 24 29  2  0
  7 30  1  6
  6 31  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5220593

    ---

Associated Targets(Human)

PTPN1 Tchem Protein-tyrosine phosphatase 1B (8528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN2 Tchem T-cell protein-tyrosine phosphatase (1317 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.38Molecular Weight (Monoisotopic): 432.1056AlogP: -0.81#Rotatable Bonds: 4
Polar Surface Area: 173.98Molecular Species: NEUTRALHBA: 10HBD: 6
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.98CX Basic pKa: CX LogP: 0.42CX LogD: -0.15
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: 1.80

References

1. Zhang Z, Shang ZP, Jiang Y, Qu ZX, Yang RY, Zhang J, Lin YX, Zhao F..  (2022)  Selective Inhibition of PTP1B by New Anthraquinone Glycosides from Knoxia valerianoides.,  85  (12.0): [PMID:36399709] [10.1021/acs.jnatprod.2c00879]

Source