6-acetyl-8-cyclopentyl-2-[4-[4-(4-methylpiperazin-1-yl)-1-piperidyl]anilino]pteridin-7-one

ID: ALA5220597

PubChem CID: 168299875

Max Phase: Preclinical

Molecular Formula: C29H38N8O2

Molecular Weight: 530.68

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)c1nc2cnc(Nc3ccc(N4CCC(N5CCN(C)CC5)CC4)cc3)nc2n(C2CCCC2)c1=O

Standard InChI:  InChI=1S/C29H38N8O2/c1-20(38)26-28(39)37(24-5-3-4-6-24)27-25(32-26)19-30-29(33-27)31-21-7-9-22(10-8-21)35-13-11-23(12-14-35)36-17-15-34(2)16-18-36/h7-10,19,23-24H,3-6,11-18H2,1-2H3,(H,30,31,33)

Standard InChI Key:  OJOXAEQFLONDRX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   -1.4263    4.1263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7117    4.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    4.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    3.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7099    2.8897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263    3.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    4.5392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4294    4.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4294    3.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    2.8888    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    2.8888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    4.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    5.3644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8587    4.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    2.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3820    1.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1271    0.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3023    0.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0474    1.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1409    2.8852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1409    2.0600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263    1.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4271    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420    0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8538    0.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8587    1.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -0.4134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4274   -0.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4274   -1.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -2.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8566   -1.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8566   -0.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -2.8889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4274   -3.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4274   -4.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -4.5393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8566   -4.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8566   -3.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -5.3644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  9 11  2  0
  8 12  1  0
 12 13  2  0
 12 14  1  0
 10 15  1  0
 16 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
  6 20  1  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
 24 27  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 27 32  1  0
 30 33  1  0
 34 33  1  0
 35 34  1  0
 36 35  1  0
 37 36  1  0
 38 37  1  0
 33 38  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220597

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4/cyclin D1 (2340 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CCND1 Tchem CDK6/cyclin D1 (322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 530.68Molecular Weight (Monoisotopic): 530.3118AlogP: 3.46#Rotatable Bonds: 6
Polar Surface Area: 99.49Molecular Species: BASEHBA: 10HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.51CX LogP: 3.51CX LogD: 2.31
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.48Np Likeness Score: -1.17

References

1. He H, Liu Q, Chen L, Wang J, Yuan Y, Li H, Qian X, Zhao Z, Chen Z..  (2022)  Design, synthesis and biological evaluation of pteridine-7(8H)-one derivatives as potent and selective CDK4/6 inhibitors.,  76  [PMID:36130661] [10.1016/j.bmcl.2022.128991]

Source