The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-acetyl-8-cyclopentyl-2-[4-[4-(4-methylpiperazin-1-yl)-1-piperidyl]anilino]pteridin-7-one ID: ALA5220597
PubChem CID: 168299875
Max Phase: Preclinical
Molecular Formula: C29H38N8O2
Molecular Weight: 530.68
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1nc2cnc(Nc3ccc(N4CCC(N5CCN(C)CC5)CC4)cc3)nc2n(C2CCCC2)c1=O
Standard InChI: InChI=1S/C29H38N8O2/c1-20(38)26-28(39)37(24-5-3-4-6-24)27-25(32-26)19-30-29(33-27)31-21-7-9-22(10-8-21)35-13-11-23(12-14-35)36-17-15-34(2)16-18-36/h7-10,19,23-24H,3-6,11-18H2,1-2H3,(H,30,31,33)
Standard InChI Key: OJOXAEQFLONDRX-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
-1.4263 4.1263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7117 4.5386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0001 4.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0001 3.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7099 2.8897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4263 3.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 4.5392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4294 4.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4294 3.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 2.8888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1440 2.8888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1440 4.5392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1440 5.3644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8587 4.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 2.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3820 1.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1271 0.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3023 0.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0474 1.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1409 2.8852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1409 2.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4263 1.6471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4271 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 0.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8538 0.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8587 1.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 -0.4134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4274 -0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4274 -1.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 -2.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8566 -1.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8566 -0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 -2.8889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4274 -3.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4274 -4.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 -4.5393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8566 -4.1267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8566 -3.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 -5.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 1 0
4 10 1 0
9 11 2 0
8 12 1 0
12 13 2 0
12 14 1 0
10 15 1 0
16 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
6 20 1 0
20 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
24 27 1 0
28 27 1 0
29 28 1 0
30 29 1 0
31 30 1 0
32 31 1 0
27 32 1 0
30 33 1 0
34 33 1 0
35 34 1 0
36 35 1 0
37 36 1 0
38 37 1 0
33 38 1 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.68Molecular Weight (Monoisotopic): 530.3118AlogP: 3.46#Rotatable Bonds: 6Polar Surface Area: 99.49Molecular Species: BASEHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.51CX LogP: 3.51CX LogD: 2.31Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.48Np Likeness Score: -1.17
References 1. He H, Liu Q, Chen L, Wang J, Yuan Y, Li H, Qian X, Zhao Z, Chen Z.. (2022) Design, synthesis and biological evaluation of pteridine-7(8H)-one derivatives as potent and selective CDK4/6 inhibitors., 76 [PMID:36130661 ] [10.1016/j.bmcl.2022.128991 ]