Ethyl 1-([1,1'-Biphenyl]-4-yl)-4-hydroxy-5-oxo-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5220662

PubChem CID: 168298395

Max Phase: Preclinical

Molecular Formula: C25H21NO4

Molecular Weight: 399.45

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(c2ccc(-c3ccccc3)cc2)C1c1ccccc1

Standard InChI:  InChI=1S/C25H21NO4/c1-2-30-25(29)21-22(19-11-7-4-8-12-19)26(24(28)23(21)27)20-15-13-18(14-16-20)17-9-5-3-6-10-17/h3-16,22,27H,2H2,1H3

Standard InChI Key:  JEUYUQUHSLUWFN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    0.5937    1.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4187    1.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6688    0.7123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0153    0.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3478    0.7335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4488    0.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0153   -0.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4656    0.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0488    1.0821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6790   -0.2978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8311    2.2306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1813    2.2306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7295   -0.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7287   -1.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0142   -2.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2979   -0.9973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8455    0.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4287    1.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3027   -1.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6625   -0.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4570   -0.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0404    0.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8295    0.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0346    1.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8371   -0.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0508   -0.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8454   -1.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4287   -0.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2178    0.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4229    0.4669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  4  1  0
  1  5  1  0
  5  6  1  0
  4  7  1  0
  3  8  1  0
  8  9  1  0
  8 10  2  0
  2 11  1  0
  1 12  2  0
 13  7  2  0
 14 13  1  0
 15 14  2  0
  7 16  1  0
  9 17  1  0
 17 18  1  0
 16 19  2  0
 19 15  1  0
 20  6  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
  6 24  1  0
 25 22  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 25 30  1  0
 30 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5220662

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 399.45Molecular Weight (Monoisotopic): 399.1471AlogP: 4.82#Rotatable Bonds: 5
Polar Surface Area: 66.84Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.16CX Basic pKa: CX LogP: 4.54CX LogD: 4.47
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -0.76

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source