The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[[4-(2-cyanophenyl)piperazin-1-yl]methyl]-1-methyl-5-(4-phenylpiperazine-1-carbonyl)pyrrole-2-carbonitrile ID: ALA5220716
PubChem CID: 134515696
Max Phase: Preclinical
Molecular Formula: C29H31N7O
Molecular Weight: 493.62
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c(C(=O)N2CCN(c3ccccc3)CC2)cc(CN2CCN(c3ccccc3C#N)CC2)c1C#N
Standard InChI: InChI=1S/C29H31N7O/c1-32-27(29(37)36-17-15-34(16-18-36)25-8-3-2-4-9-25)19-24(28(32)21-31)22-33-11-13-35(14-12-33)26-10-6-5-7-23(26)20-30/h2-10,19H,11-18,22H2,1H3
Standard InChI Key: YKMDFLBFXDXLSC-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-0.2985 -1.5801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9660 -1.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7111 -0.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1139 -0.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3688 -1.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2985 -2.4053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1658 -1.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5264 0.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3516 0.4041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7642 1.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5894 1.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0019 0.4040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5894 -0.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7642 -0.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8271 0.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2399 1.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0626 1.1178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4753 0.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0662 -0.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2414 -0.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8289 -1.0282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7630 -1.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9766 -2.1058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3465 -0.7253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1436 -0.9388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7270 -0.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5135 0.4416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7164 0.6552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1329 0.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0970 1.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9629 -1.5223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8941 0.8117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4753 1.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2616 2.1913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4690 2.4053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8824 1.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4163 -1.7428 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
1 6 1 0
5 7 1 0
4 8 1 0
8 9 1 0
10 9 1 0
11 10 1 0
12 11 1 0
13 12 1 0
14 13 1 0
9 14 1 0
12 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
20 21 1 0
2 22 1 0
22 23 2 0
22 24 1 0
25 24 1 0
26 25 1 0
27 26 1 0
28 27 1 0
29 28 1 0
24 29 1 0
27 30 1 0
7 31 3 0
32 30 2 0
33 32 1 0
34 33 2 0
35 34 1 0
36 35 2 0
30 36 1 0
21 37 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.62Molecular Weight (Monoisotopic): 493.2590AlogP: 3.05#Rotatable Bonds: 5Polar Surface Area: 82.54Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.43CX LogP: 3.54CX LogD: 3.54Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.54Np Likeness Score: -1.50
References 1. Oleksak P, Nepovimova E, Chrienova Z, Musilek K, Patocka J, Kuca K.. (2022) Contemporary mTOR inhibitor scaffolds to diseases breakdown: A patent review (2015-2021)., 238 [PMID:35688004 ] [10.1016/j.ejmech.2022.114498 ]