3-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-N-methyl-benzamide

ID: ALA5220752

PubChem CID: 156560498

Max Phase: Preclinical

Molecular Formula: C28H28N6O3

Molecular Weight: 496.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)c1cccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOc5ccccc54)nc3n2)c1

Standard InChI:  InChI=1S/C28H28N6O3/c1-18-17-36-14-12-33(18)26-21-10-11-22(19-6-5-7-20(16-19)27(35)29-2)30-25(21)31-28(32-26)34-13-15-37-24-9-4-3-8-23(24)34/h3-11,16,18H,12-15,17H2,1-2H3,(H,29,35)/t18-/m0/s1

Standard InChI Key:  YBQZFRVXNIAXTF-SFHVURJKSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   -1.7619    0.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4835    0.4187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4981   -0.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7909   -0.8311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0693   -0.4312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0548    0.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3642   -0.8545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3577   -0.4548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3739    0.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3300    0.7948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0720   -0.8671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7863   -0.4549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4981   -0.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4981   -1.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7882   -2.1034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0720   -1.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2124   -0.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2124    0.3703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9266   -0.8668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6408   -0.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7619    1.6432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4761    2.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4761    2.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7619    3.2927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0477    2.8804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0477    2.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1904    1.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2124   -0.8185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2124   -1.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9266   -2.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6408   -1.6432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6408   -0.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9266   -0.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4981   -2.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4981   -2.8804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2124   -3.2927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9266   -2.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  6 10  1  0
  8 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 13 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
  1 21  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 21 26  1  0
 22 27  1  1
  3 28  1  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 28 33  1  0
 29 34  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 30 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220752

    ---

Associated Targets(Human)

MTOR Tclin mTORC1 (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.57Molecular Weight (Monoisotopic): 496.2223AlogP: 3.81#Rotatable Bonds: 4
Polar Surface Area: 92.71Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.55CX LogD: 4.55
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.46Np Likeness Score: -1.26

References

1. Oleksak P, Nepovimova E, Chrienova Z, Musilek K, Patocka J, Kuca K..  (2022)  Contemporary mTOR inhibitor scaffolds to diseases breakdown: A patent review (2015-2021).,  238  [PMID:35688004] [10.1016/j.ejmech.2022.114498]

Source