4-[4-(Benzenesulfonyl)-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl]-5-methoxy-2-(2-methylphenoxy)benzonitrile

ID: ALA5220763

PubChem CID: 156716079

Max Phase: Preclinical

Molecular Formula: C25H19N3O6S

Molecular Weight: 489.51

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(C#N)c(Oc2ccccc2C)cc1-n1c(=O)cc(S(=O)(=O)c2ccccc2)[nH]c1=O

Standard InChI:  InChI=1S/C25H19N3O6S/c1-16-8-6-7-11-20(16)34-21-13-19(22(33-2)12-17(21)15-26)28-24(29)14-23(27-25(28)30)35(31,32)18-9-4-3-5-10-18/h3-14H,1-2H3,(H,27,30)

Standard InChI Key:  XUMXYRYBRHREOC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -1.7300   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0156    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3010   -0.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3010   -1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0156   -1.4439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7300   -1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4131   -1.4438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4131    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4132    1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1258    1.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8404    1.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8420    0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1305   -0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5547    1.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2690    1.8537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1258    2.2661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8402    2.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8404    3.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5529    3.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2674    3.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2690    2.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5576    2.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0156    1.0309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1261    3.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1305   -1.0327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8447   -1.4451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4443   -1.4437    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4443   -2.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2690   -1.4437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6577   -0.6471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7301   -2.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7309   -3.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4454   -3.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1568   -3.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1616   -2.6826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  2  0
  6  5  1  0
  4  7  2  0
  3  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 11 14  1  0
 14 15  3  0
 10 16  1  0
 16 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
  2 23  2  0
 18 24  1  0
 13 25  1  0
 25 26  1  0
  6 27  1  0
 27 28  1  0
 27 29  2  0
 27 30  2  0
 31 28  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 28 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220763

    ---

Associated Targets(Human)

BCAT1 Tchem Branched-chain-amino-acid transferase (80 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 489.51Molecular Weight (Monoisotopic): 489.0995AlogP: 3.34#Rotatable Bonds: 6
Polar Surface Area: 131.25Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.91CX Basic pKa: CX LogP: 4.13CX LogD: 4.02
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.04

References

1. Günther J, Hillig RC, Zimmermann K, Kaulfuss S, Lemos C, Nguyen D, Rehwinkel H, Habgood M, Lechner C, Neuhaus R, Ganzer U, Drewes M, Chai J, Bouché L..  (2022)  BAY-069, a Novel (Trifluoromethyl)pyrimidinedione-Based BCAT1/2 Inhibitor and Chemical Probe.,  65  (21.0): [PMID:36261130] [10.1021/acs.jmedchem.2c00441]
2. Bertrand, Sophie M SM and 31 more authors.  2015-09-24  The Discovery of in Vivo Active Mitochondrial Branched-Chain Aminotransferase (BCATm) Inhibitors by Hybridizing Fragment and HTS Hits.  [PMID:26090771]

Source