The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 2-([1,1'-Biphenyl]-4-yl)-1-(6-bromobenzo[d]thiazol-2-yl)-4-hydroxy-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate ID: ALA5220784
PubChem CID: 168299487
Max Phase: Preclinical
Molecular Formula: C26H19BrN2O4S
Molecular Weight: 535.42
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(O)C(=O)N(c2nc3ccc(Br)cc3s2)C1c1ccc(-c2ccccc2)cc1
Standard InChI: InChI=1S/C26H19BrN2O4S/c1-2-33-25(32)21-22(17-10-8-16(9-11-17)15-6-4-3-5-7-15)29(24(31)23(21)30)26-28-19-13-12-18(27)14-20(19)34-26/h3-14,22,30H,2H2,1H3
Standard InChI Key: HGQQTRLCOBKUPM-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
0.0741 2.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8991 2.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1493 1.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4957 1.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1716 1.9695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9682 1.7561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1817 0.9594 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.0227 0.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3081 1.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6604 2.1960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1062 1.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6113 1.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3257 0.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5308 0.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4957 0.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2099 0.2402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2091 -0.5819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4947 -0.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2167 -0.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2214 0.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4947 -1.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2088 -2.2317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2081 -3.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4937 -3.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2177 -3.0575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2225 -2.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9459 1.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5290 2.3180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3257 2.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9088 2.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1593 0.9382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3115 3.4665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3381 3.4665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9088 -0.1494 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
5 4 1 0
1 5 1 0
6 5 1 0
6 7 1 0
7 8 1 0
8 9 2 0
10 9 1 0
6 10 2 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
8 14 1 0
4 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
21 18 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
3 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
27 31 2 0
2 32 1 0
1 33 2 0
13 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.42Molecular Weight (Monoisotopic): 534.0249AlogP: 6.19#Rotatable Bonds: 5Polar Surface Area: 79.73Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.54CX Basic pKa: ┄CX LogP: 6.13CX LogD: 5.90Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.38
References 1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M.. (2022) Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA., 65 (21.0): [PMID:36269107 ] [10.1021/acs.jmedchem.2c01275 ]