Ethyl 2-([1,1'-Biphenyl]-4-yl)-1-(6-bromobenzo[d]thiazol-2-yl)-4-hydroxy-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5220784

PubChem CID: 168299487

Max Phase: Preclinical

Molecular Formula: C26H19BrN2O4S

Molecular Weight: 535.42

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(c2nc3ccc(Br)cc3s2)C1c1ccc(-c2ccccc2)cc1

Standard InChI:  InChI=1S/C26H19BrN2O4S/c1-2-33-25(32)21-22(17-10-8-16(9-11-17)15-6-4-3-5-7-15)29(24(31)23(21)30)26-28-19-13-12-18(27)14-20(19)34-26/h3-14,22,30H,2H2,1H3

Standard InChI Key:  HGQQTRLCOBKUPM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    0.0741    2.7523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8991    2.7523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1493    1.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4957    1.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1716    1.9695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9682    1.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1817    0.9594    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0227    0.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3081    1.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6604    2.1960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1062    1.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6113    1.1820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3257    0.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5308    0.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4957    0.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2099    0.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2091   -0.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4947   -0.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2167   -0.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2214    0.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4947   -1.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2088   -2.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2081   -3.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4937   -3.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2177   -3.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2225   -2.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9459    1.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5290    2.3180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3257    2.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9088    2.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1593    0.9382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3115    3.4665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3381    3.4665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9088   -0.1494    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  4  1  0
  1  5  1  0
  6  5  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
 10  9  1  0
  6 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
  8 14  1  0
  4 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 21 18  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
  3 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 27 31  2  0
  2 32  1  0
  1 33  2  0
 13 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220784

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.42Molecular Weight (Monoisotopic): 534.0249AlogP: 6.19#Rotatable Bonds: 5
Polar Surface Area: 79.73Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.54CX Basic pKa: CX LogP: 6.13CX LogD: 5.90
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.38

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source