The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-((2-((3-chloro-2-fluorobenzyl)amino)-2-oxoethyl)(cyclopropyl)amino)-2-oxoethyl)-6-(hydroxymethyl)-1H-indazole-3-carboxamide ID: ALA5220812
PubChem CID: 130299610
Max Phase: Preclinical
Molecular Formula: C23H23ClFN5O4
Molecular Weight: 487.92
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1nn(CC(=O)N(CC(=O)NCc2cccc(Cl)c2F)C2CC2)c2cc(CO)ccc12
Standard InChI: InChI=1S/C23H23ClFN5O4/c24-17-3-1-2-14(21(17)25)9-27-19(32)10-29(15-5-6-15)20(33)11-30-18-8-13(12-31)4-7-16(18)22(28-30)23(26)34/h1-4,7-8,15,31H,5-6,9-12H2,(H2,26,34)(H,27,32)
Standard InChI Key: UYOQIJAROUNQLT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
0.0120 1.9472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8129 1.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4012 1.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4012 0.4061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1127 -0.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8304 0.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5419 -0.0221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2870 0.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5065 1.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3022 1.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8813 0.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6611 -0.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8620 -0.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4776 -0.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6632 -0.8140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8849 -1.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7100 -1.6689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4671 -2.3742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1066 -0.8367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3162 -0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0277 0.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0217 1.2418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7454 0.0094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4568 0.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1744 0.0199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8861 0.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8801 1.2627 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.6013 0.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3128 0.4486 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.6073 -0.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9001 -1.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1805 -0.8085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5158 2.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3128 2.3742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 1 1 0
3 2 1 0
3 4 1 0
5 4 1 0
6 5 1 0
7 6 1 0
8 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
13 8 1 0
12 13 2 0
13 14 1 0
14 15 2 0
7 15 1 0
14 16 1 0
16 17 1 0
16 18 2 0
5 19 2 0
4 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
26 25 2 0
26 27 1 0
28 26 1 0
28 29 1 0
30 28 2 0
31 30 1 0
25 32 1 0
32 31 2 0
10 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.92Molecular Weight (Monoisotopic): 487.1423AlogP: 1.73#Rotatable Bonds: 9Polar Surface Area: 130.55Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.39CX Basic pKa: ┄CX LogP: 0.84CX LogD: 0.84Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.74
References 1. Zhang W, Wu M, Vadlakonda S, Juarez L, Cheng X, Muppa S, Chintareddy V, Vogeti L, Kellogg-Yelder D, Williams J, Polach K, Chen X, Raman K, Babu YS, Kotian P.. (2022) Scaffold hopping via ring opening enables identification of acyclic compounds as new complement Factor D inhibitors., 74 [PMID:36272185 ] [10.1016/j.bmc.2022.117034 ]