6-acetyl-8-cyclopentyl-2-(4-morpholinoanilino)pteridin-7-one

ID: ALA5220828

PubChem CID: 168299881

Max Phase: Preclinical

Molecular Formula: C23H26N6O3

Molecular Weight: 434.50

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)c1nc2cnc(Nc3ccc(N4CCOCC4)cc3)nc2n(C2CCCC2)c1=O

Standard InChI:  InChI=1S/C23H26N6O3/c1-15(30)20-22(31)29(18-4-2-3-5-18)21-19(26-20)14-24-23(27-21)25-16-6-8-17(9-7-16)28-10-12-32-13-11-28/h6-9,14,18H,2-5,10-13H2,1H3,(H,24,25,27)

Standard InChI Key:  FOONPBHFJMPFDT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -1.4263    2.4759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7117    2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    2.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0001    1.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7099    1.2394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263    1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    2.8889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4294    2.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4294    1.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    1.2385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    1.2385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    2.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    3.7140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8586    2.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3820   -0.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1271   -0.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3023   -0.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0475   -0.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1410    1.2348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1410    0.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4264   -0.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4271   -0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -1.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8539   -0.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8586   -0.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -2.0637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273   -2.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273   -3.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -3.7140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8566   -3.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8566   -2.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  9 11  2  0
  8 12  1  0
 12 13  2  0
 12 14  1  0
 10 15  1  0
 16 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
  6 20  1  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
 24 27  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220828

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4/cyclin D1 (2340 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CCND1 Tchem CDK6/cyclin D1 (322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.50Molecular Weight (Monoisotopic): 434.2066AlogP: 3.08#Rotatable Bonds: 5
Polar Surface Area: 102.24Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.29CX LogP: 3.42CX LogD: 3.42
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -1.29

References

1. He H, Liu Q, Chen L, Wang J, Yuan Y, Li H, Qian X, Zhao Z, Chen Z..  (2022)  Design, synthesis and biological evaluation of pteridine-7(8H)-one derivatives as potent and selective CDK4/6 inhibitors.,  76  [PMID:36130661] [10.1016/j.bmcl.2022.128991]

Source