The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-aminocyclohexyl)-4'-((4-oxo-4,5,6,7-tetrahydro-3H-cyclopenta[d]pyrimidin-2-ylthio)methyl)biphenyl-4-sulfonamide ID: ALA5220833
PubChem CID: 168299886
Max Phase: Preclinical
Molecular Formula: C26H30N4O3S2
Molecular Weight: 510.69
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC1CCCC(NS(=O)(=O)c2ccc(-c3ccc(CSc4nc5c(c(=O)[nH]4)CCC5)cc3)cc2)C1
Standard InChI: InChI=1S/C26H30N4O3S2/c27-20-3-1-4-21(15-20)30-35(32,33)22-13-11-19(12-14-22)18-9-7-17(8-10-18)16-34-26-28-24-6-2-5-23(24)25(31)29-26/h7-14,20-21,30H,1-6,15-16,27H2,(H,28,29,31)
Standard InChI Key: MDTVXTHPTRFSHT-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-3.4360 0.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7214 0.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0095 0.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0095 -0.4097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7195 -0.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4360 -0.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1506 -0.8260 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.1506 -1.6512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4360 -2.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5640 -0.1100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9757 -0.8260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2948 0.8280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2946 1.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5818 2.0640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1330 1.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1346 0.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5772 0.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8476 2.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5623 1.6512 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.2769 2.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2769 2.8889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9915 3.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7061 2.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7061 2.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9915 1.6512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4908 1.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9757 2.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4909 3.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9915 4.1268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7214 -1.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0068 -2.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0068 -2.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7214 -3.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4360 -2.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7214 -4.1268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
9 8 1 0
7 10 2 0
7 11 2 0
12 3 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
18 19 1 0
19 20 1 0
21 20 1 0
22 21 1 0
23 22 1 0
24 23 2 0
25 24 1 0
20 25 2 0
24 26 1 0
27 26 1 0
28 27 1 0
23 28 1 0
22 29 2 0
30 9 1 0
31 30 1 0
32 31 1 0
33 32 1 0
34 33 1 0
9 34 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.69Molecular Weight (Monoisotopic): 510.1759AlogP: 3.77#Rotatable Bonds: 7Polar Surface Area: 117.94Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.65CX Basic pKa: 9.78CX LogP: 2.94CX LogD: 2.55Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -1.38
References 1. Fuerst R, Choi JY, Knapinska AM, Cameron MD, Ruiz C, Delmas A, Sundrud MS, Fields GB, Roush WR.. (2022) Development of a putative Zn2+ -chelating but highly selective MMP-13 inhibitor., 76 [PMID:36202189 ] [10.1016/j.bmcl.2022.129014 ]