Tert-butyl (3-carbamoyl-1-(2-((2-((3-chloro-2-fluorobenzyl)amino)-2-oxoethyl)(cyclopropyl)amino)-2-oxoethyl)-1H-indazol-5-yl)carbamate

ID: ALA5220843

PubChem CID: 168298056

Max Phase: Preclinical

Molecular Formula: C27H30ClFN6O5

Molecular Weight: 573.02

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)Nc1ccc2c(c1)c(C(N)=O)nn2CC(=O)N(CC(=O)NCc1cccc(Cl)c1F)C1CC1

Standard InChI:  InChI=1S/C27H30ClFN6O5/c1-27(2,3)40-26(39)32-16-7-10-20-18(11-16)24(25(30)38)33-35(20)14-22(37)34(17-8-9-17)13-21(36)31-12-15-5-4-6-19(28)23(15)29/h4-7,10-11,17H,8-9,12-14H2,1-3H3,(H2,30,38)(H,31,36)(H,32,39)

Standard InChI Key:  VBJJJLBIQQMABQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
    5.4426    1.4760    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.4487    0.6510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7371    0.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0195    0.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3082    0.2229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5907    0.6302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5846    1.4551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8792    0.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1617    0.6196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1617    1.4447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5750    2.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7501    2.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4504    0.2019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2671    0.6091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9785    0.1913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7236    0.5740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9430    1.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7386    1.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3177    0.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0974    0.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2985   -0.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9141   -0.7315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0998   -0.6005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3213   -1.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1463   -1.4551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9036   -2.1604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4564   -0.6230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7432   -0.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4627   -0.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1698   -0.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1637    0.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8751    0.6622    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.1146    1.2032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6978    0.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4948    0.8334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4844   -0.1770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0782    0.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8751    0.4636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8647   -0.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6616   -0.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  6  7  2  0
  8  6  1  0
  9  8  1  0
 10  9  1  0
 10 11  1  0
 11 12  1  0
 10 12  1  0
 13  9  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 21 22  1  0
 15 23  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 24 26  2  0
 13 27  2  0
  3 28  1  0
 28 29  2  0
 29 30  1  0
 31  2  1  0
 30 31  2  0
 31 32  1  0
 19 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 37 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220843

    ---

Associated Targets(Human)

CFD Tchem Complement factor D (1353 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 573.02Molecular Weight (Monoisotopic): 572.1950AlogP: 3.58#Rotatable Bonds: 9
Polar Surface Area: 148.65Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.78CX Basic pKa: CX LogP: 2.52CX LogD: 2.52
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.36Np Likeness Score: -2.06

References

1. Zhang W, Wu M, Vadlakonda S, Juarez L, Cheng X, Muppa S, Chintareddy V, Vogeti L, Kellogg-Yelder D, Williams J, Polach K, Chen X, Raman K, Babu YS, Kotian P..  (2022)  Scaffold hopping via ring opening enables identification of acyclic compounds as new complement Factor D inhibitors.,  74  [PMID:36272185] [10.1016/j.bmc.2022.117034]

Source