The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(methylamino)propyl)-4'-((4-oxo-4,5,6,7-tetrahydro-3H-cyclopenta[d]pyrimidin-2-ylthio)methyl)biphenyl-4-sulfonamide ID: ALA5220881
PubChem CID: 168298532
Max Phase: Preclinical
Molecular Formula: C24H28N4O3S2
Molecular Weight: 484.65
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNCCCNS(=O)(=O)c1ccc(-c2ccc(CSc3nc4c(c(=O)[nH]3)CCC4)cc2)cc1
Standard InChI: InChI=1S/C24H28N4O3S2/c1-25-14-3-15-26-33(30,31)20-12-10-19(11-13-20)18-8-6-17(7-9-18)16-32-24-27-22-5-2-4-21(22)23(29)28-24/h6-13,25-26H,2-5,14-16H2,1H3,(H,27,28,29)
Standard InChI Key: JTUCBCNWROIZHI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-3.4361 -0.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7214 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0096 -0.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0096 -1.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7197 -1.8531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4361 -1.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1508 -1.8575 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.1508 -2.6828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4361 -3.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5641 -1.1416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9760 -1.8575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2949 -0.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2947 0.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5818 1.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1330 0.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1346 -0.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5772 -0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8477 1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5624 0.6197 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.2770 1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2770 1.8575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9916 2.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7063 1.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7063 1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9916 0.6197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4910 0.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9760 1.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4911 2.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9916 3.0954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7214 -2.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0068 -3.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2921 -2.6828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5775 -3.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
9 8 1 0
7 10 2 0
7 11 2 0
12 3 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
18 19 1 0
19 20 1 0
21 20 1 0
22 21 1 0
23 22 1 0
24 23 2 0
25 24 1 0
20 25 2 0
24 26 1 0
27 26 1 0
28 27 1 0
23 28 1 0
22 29 2 0
9 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.65Molecular Weight (Monoisotopic): 484.1603AlogP: 3.11#Rotatable Bonds: 10Polar Surface Area: 103.95Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.65CX Basic pKa: 10.50CX LogP: 2.21CX LogD: 1.80Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.23Np Likeness Score: -1.45
References 1. Fuerst R, Choi JY, Knapinska AM, Cameron MD, Ruiz C, Delmas A, Sundrud MS, Fields GB, Roush WR.. (2022) Development of a putative Zn2+ -chelating but highly selective MMP-13 inhibitor., 76 [PMID:36202189 ] [10.1016/j.bmcl.2022.129014 ]