The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[(4-amino-6-cyclopropyl-1,3,5-triazin-2-yl)amino]-2-[3-[(E)-2-cyanovinyl]phenoxy]benzonitrile ID: ALA5220892
PubChem CID: 56600061
Max Phase: Preclinical
Molecular Formula: C22H17N7O
Molecular Weight: 395.43
Associated Items:
Names and Identifiers Canonical SMILES: N#C/C=C/c1cccc(Oc2cc(Nc3nc(N)nc(C4CC4)n3)ccc2C#N)c1
Standard InChI: InChI=1S/C22H17N7O/c23-10-2-4-14-3-1-5-18(11-14)30-19-12-17(9-8-16(19)13-24)26-22-28-20(15-6-7-15)27-21(25)29-22/h1-5,8-9,11-12,15H,6-7H2,(H3,25,26,27,28,29)/b4-2+
Standard InChI Key: AMEGFBPUWXJNSC-DUXPYHPUSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-3.5165 -0.4665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5165 -1.2915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2309 -1.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8020 -1.7041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0875 -1.2915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3731 -1.7041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0875 -0.4665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8020 -0.0541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8020 0.7708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6584 -1.2915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6581 -0.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0547 -0.0555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7696 -0.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7711 -1.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0592 -1.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4842 -0.0556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0578 -1.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6444 -2.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1989 0.3570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0547 0.7697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7694 1.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7696 2.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4825 2.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1974 2.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1990 1.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4871 0.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9136 0.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6284 1.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3431 0.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0578 0.3592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
4 5 1 0
5 6 1 0
5 7 2 0
7 8 1 0
8 1 2 0
8 9 1 0
10 6 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
13 16 1 0
17 3 1 0
17 18 1 0
3 18 1 0
16 19 3 0
12 20 1 0
20 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 3 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 395.43Molecular Weight (Monoisotopic): 395.1495AlogP: 4.28#Rotatable Bonds: 6Polar Surface Area: 133.53Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.53CX Basic pKa: 6.50CX LogP: 4.70CX LogD: 4.65Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.15
References 1. Shahari MSB, Dolzhenko AV.. (2022) A closer look at N2 ,6-substituted 1,3,5-triazine-2,4-diamines: Advances in synthesis and biological activities., 241 [PMID:35981459 ] [10.1016/j.ejmech.2022.114645 ]