Ethyl 2-([1,1'-Biphenyl]-4-yl)-1-(benzo[d]thiazol-2-yl)-4-hydroxy-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5220921

PubChem CID: 168299104

Max Phase: Preclinical

Molecular Formula: C26H20N2O4S

Molecular Weight: 456.52

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(c2nc3ccccc3s2)C1c1ccc(-c2ccccc2)cc1

Standard InChI:  InChI=1S/C26H20N2O4S/c1-2-32-25(31)21-22(18-14-12-17(13-15-18)16-8-4-3-5-9-16)28(24(30)23(21)29)26-27-19-10-6-7-11-20(19)33-26/h3-15,22,29H,2H2,1H3

Standard InChI Key:  ISLIWKMUWNZCLC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -0.0745    2.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7504    2.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0004    1.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3470    1.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3204    1.9695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3470    0.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7971    1.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3803    2.3179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0106    0.9382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1627    3.4665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4869    3.4665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1769    2.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7601    2.6876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0611    0.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0604   -0.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3460   -0.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3654   -0.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3703    0.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3460   -1.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0601   -2.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0593   -3.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3449   -3.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3665   -3.0575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3713   -2.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1170    1.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3304    0.9594    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1715    0.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4569    1.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8092    2.1959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6796    0.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4744    0.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7601    1.1820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2549    1.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  4  1  0
  1  5  1  0
  4  6  1  0
  3  7  1  0
  7  8  1  0
  7  9  2  0
  2 10  1  0
  1 11  2  0
  8 12  1  0
 12 13  1  0
 14  6  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
  6 18  1  0
 19 16  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 19 24  1  0
 24 23  2  0
 25  5  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 25 29  2  0
 29 28  1  0
 27 30  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 28 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5220921

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.52Molecular Weight (Monoisotopic): 456.1144AlogP: 5.43#Rotatable Bonds: 5
Polar Surface Area: 79.73Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.86CX Basic pKa: CX LogP: 5.36CX LogD: 5.23
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.31

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source