Ethyl 2-([1,1'-Biphenyl]-4-yl)-1-(4-chlorobenzyl)-4-hydroxy-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5220961

PubChem CID: 168299356

Max Phase: Preclinical

Molecular Formula: C26H22ClNO4

Molecular Weight: 447.92

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(Cc2ccc(Cl)cc2)C1c1ccc(-c2ccccc2)cc1

Standard InChI:  InChI=1S/C26H22ClNO4/c1-2-32-26(31)22-23(20-12-10-19(11-13-20)18-6-4-3-5-7-18)28(25(30)24(22)29)16-17-8-14-21(27)15-9-17/h3-15,23,29H,2,16H2,1H3

Standard InChI Key:  GYPASEIVAYFPAR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -0.2308    2.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5941    2.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8442    1.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1907    1.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4766    1.6588    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2733    1.4453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1907    0.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6408    1.4241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2240    2.0072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8543    0.6274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0065    3.1557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6432    3.1557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8565    2.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2340    2.3972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6532    1.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0206    3.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2283    3.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6421    2.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6038    3.7772    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.0207    1.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6038    2.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9041   -0.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9048   -0.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1896   -1.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5218   -0.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5265   -0.0720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9038   -2.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1896   -2.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9030   -3.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1886   -3.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5228   -3.3683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5276   -2.5440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  4  1  0
  1  5  1  0
  5  6  1  0
  4  7  1  0
  3  8  1  0
  8  9  1  0
  8 10  2  0
  2 11  1  0
  1 12  2  0
  6 13  1  0
 14 15  1  0
 15 13  2  0
 16 14  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
  9 20  1  0
 20 21  1  0
 22 23  1  0
 23  7  2  0
 24 22  2  0
 25 24  1  0
 26 25  2  0
  7 26  1  0
 27 28  2  0
 28 24  1  0
 29 27  1  0
 30 29  2  0
 31 30  1  0
 28 32  1  0
 32 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5220961

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.92Molecular Weight (Monoisotopic): 447.1237AlogP: 5.47#Rotatable Bonds: 6
Polar Surface Area: 66.84Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.39CX Basic pKa: CX LogP: 5.21CX LogD: 5.21
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: -0.96

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source