1-(5,7-difluoro-4-methylquinazolin-2-yl)-3-(3-(dimethylamino)propyl)guanidine

ID: ALA5221021

PubChem CID: 168298415

Max Phase: Preclinical

Molecular Formula: C15H20F2N6

Molecular Weight: 322.36

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc(NC(=N)NCCCN(C)C)nc2cc(F)cc(F)c12

Standard InChI:  InChI=1S/C15H20F2N6/c1-9-13-11(17)7-10(16)8-12(13)21-15(20-9)22-14(18)19-5-4-6-23(2)3/h7-8H,4-6H2,1-3H3,(H3,18,19,20,21,22)

Standard InChI Key:  OCGVGIHAYCSOLM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    0.3559    0.4141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559   -0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3585   -0.8234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0731   -0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7848   -0.8276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5025   -0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5025    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7898    0.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0750    0.4099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2143    0.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9288    0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9288   -0.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2125   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0705   -0.8234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851   -0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4997   -0.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2142   -0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9288   -0.8234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6434   -0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9288   -1.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7898    1.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2143    1.6485    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6434   -0.8297    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  6  7  2  0
  7  8  1  0
  9  8  2  0
  4  9  1  0
  7 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  6  1  0
  2 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
  8 21  1  0
 10 22  1  0
 12 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5221021

    ---

Associated Targets(Human)

Premature termination codon (106 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.36Molecular Weight (Monoisotopic): 322.1718AlogP: 2.10#Rotatable Bonds: 5
Polar Surface Area: 76.93Molecular Species: BASEHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.81CX LogP: 1.85CX LogD: 0.21
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.45Np Likeness Score: -1.38

References

1. Morrill C, Friesen WJ, Babu S, Baiazitov RY, Du W, Karloff DB, Lee CS, Moon YC, Ren H, Sierra J, Tomizawa Y, Vazirani P, Welch EM, Xue X, Zhuo J..  (2022)  Guanidino quinazolines and pyrimidines promote readthrough of premature termination codons in cells with native nonsense mutations.,  76  [PMID:36150638] [10.1016/j.bmcl.2022.128989]

Source