6-acetyl-8-cyclopentyl-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]pteridin-7-one

ID: ALA5221074

PubChem CID: 168298906

Max Phase: Preclinical

Molecular Formula: C25H31N7O3

Molecular Weight: 477.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(N2CCN(C)CC2)ccc1Nc1ncc2nc(C(C)=O)c(=O)n(C3CCCC3)c2n1

Standard InChI:  InChI=1S/C25H31N7O3/c1-16(33)22-24(34)32(17-6-4-5-7-17)23-20(27-22)15-26-25(29-23)28-19-9-8-18(14-21(19)35-3)31-12-10-30(2)11-13-31/h8-9,14-15,17H,4-7,10-13H2,1-3H3,(H,26,28,29)

Standard InChI Key:  XOXVIZNYGNMVCG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -0.7116    2.8885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0028    3.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    2.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    2.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0046    1.6519    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7116    2.0600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4294    3.3014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    2.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    2.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4294    1.6511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8586    1.6511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8586    3.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4294    0.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0966    0.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8417   -0.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0169   -0.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7621    0.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263    1.6474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263    0.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7117    0.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7125   -0.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273   -0.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1392   -0.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1440    0.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273   -1.6511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7128   -2.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7128   -2.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273   -3.3015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -2.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -2.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273   -4.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8586    4.1267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5733    2.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8586    0.8205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5733    0.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  9 11  2  0
  8 12  1  0
 10 13  1  0
 14 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  6 18  1  0
 18 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 22 25  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 25 30  1  0
 28 31  1  0
 12 32  2  0
 12 33  1  0
 24 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5221074

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4/cyclin D1 (2340 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CCND1 Tchem CDK6/cyclin D1 (322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.57Molecular Weight (Monoisotopic): 477.2488AlogP: 3.01#Rotatable Bonds: 6
Polar Surface Area: 105.48Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.82CX Basic pKa: 7.84CX LogP: 3.32CX LogD: 2.75
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.54Np Likeness Score: -1.17

References

1. He H, Liu Q, Chen L, Wang J, Yuan Y, Li H, Qian X, Zhao Z, Chen Z..  (2022)  Design, synthesis and biological evaluation of pteridine-7(8H)-one derivatives as potent and selective CDK4/6 inhibitors.,  76  [PMID:36130661] [10.1016/j.bmcl.2022.128991]

Source