Methyl (S)-4-methyl-3-((2-((3-(trifluoromethoxy)phenyl)carbamoyl)pyrrolidine-1-carboxamido)methyl)benzoate

ID: ALA5221126

PubChem CID: 168299895

Max Phase: Preclinical

Molecular Formula: C23H24F3N3O5

Molecular Weight: 479.46

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc(C)c(CNC(=O)N2CCC[C@H]2C(=O)Nc2cccc(OC(F)(F)F)c2)c1

Standard InChI:  InChI=1S/C23H24F3N3O5/c1-14-8-9-15(21(31)33-2)11-16(14)13-27-22(32)29-10-4-7-19(29)20(30)28-17-5-3-6-18(12-17)34-23(24,25)26/h3,5-6,8-9,11-12,19H,4,7,10,13H2,1-2H3,(H,27,32)(H,28,30)/t19-/m0/s1

Standard InChI Key:  SADJFWICUUZDLY-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   -1.3680    2.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5430    2.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3253    2.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9465    1.5698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5801    2.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9465    0.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2366    0.3403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6562    0.3403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6562   -0.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3659   -0.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3662   -1.7086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0742   -2.1165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7843   -1.7065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7858   -0.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0788   -0.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0788    0.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0742   -2.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3645   -3.3458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7840   -3.3458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6547   -2.9360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4662    1.8196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0458    2.3992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6784    1.0279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4701    0.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0498    1.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8388    1.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0510    0.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4754   -0.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6831    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4184    1.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2062    2.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7858    3.1337    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.4146    2.7663    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.9941    3.3458    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  1  5  1  0
  5  4  1  0
  4  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 15 16  1  0
 12 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
  3 21  1  1
 21 22  2  0
 21 23  1  0
 23 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 24 29  1  0
 26 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5221126

    ---

Associated Targets(Human)

CFD Tchem Complement factor D (1353 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.46Molecular Weight (Monoisotopic): 479.1668AlogP: 3.99#Rotatable Bonds: 6
Polar Surface Area: 96.97Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.93CX Basic pKa: CX LogP: 4.51CX LogD: 4.51
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -1.61

References

1. Zhang W, Wu M, Vadlakonda S, Juarez L, Cheng X, Muppa S, Chintareddy V, Vogeti L, Kellogg-Yelder D, Williams J, Polach K, Chen X, Raman K, Babu YS, Kotian P..  (2022)  Scaffold hopping via ring opening enables identification of acyclic compounds as new complement Factor D inhibitors.,  74  [PMID:36272185] [10.1016/j.bmc.2022.117034]

Source