The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl (S)-4-methyl-3-((2-((3-(trifluoromethoxy)phenyl)carbamoyl)pyrrolidine-1-carboxamido)methyl)benzoate ID: ALA5221126
PubChem CID: 168299895
Max Phase: Preclinical
Molecular Formula: C23H24F3N3O5
Molecular Weight: 479.46
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(C)c(CNC(=O)N2CCC[C@H]2C(=O)Nc2cccc(OC(F)(F)F)c2)c1
Standard InChI: InChI=1S/C23H24F3N3O5/c1-14-8-9-15(21(31)33-2)11-16(14)13-27-22(32)29-10-4-7-19(29)20(30)28-17-5-3-6-18(12-17)34-23(24,25)26/h3,5-6,8-9,11-12,19H,4,7,10,13H2,1-2H3,(H,27,32)(H,28,30)/t19-/m0/s1
Standard InChI Key: SADJFWICUUZDLY-IBGZPJMESA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
-1.3680 2.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5430 2.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3253 2.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9465 1.5698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5801 2.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9465 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2366 0.3403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6562 0.3403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6562 -0.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3659 -0.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3662 -1.7086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0742 -2.1165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7843 -1.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7858 -0.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0788 -0.4774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0788 0.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0742 -2.9360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3645 -3.3458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7840 -3.3458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6547 -2.9360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4662 1.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0458 2.3992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6784 1.0279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4701 0.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0498 1.3952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8388 1.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0510 0.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4754 -0.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6831 0.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4184 1.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2062 2.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7858 3.1337 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.4146 2.7663 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.9941 3.3458 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
1 5 1 0
5 4 1 0
4 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
15 16 1 0
12 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
3 21 1 1
21 22 2 0
21 23 1 0
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
26 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.46Molecular Weight (Monoisotopic): 479.1668AlogP: 3.99#Rotatable Bonds: 6Polar Surface Area: 96.97Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.93CX Basic pKa: ┄CX LogP: 4.51CX LogD: 4.51Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -1.61
References 1. Zhang W, Wu M, Vadlakonda S, Juarez L, Cheng X, Muppa S, Chintareddy V, Vogeti L, Kellogg-Yelder D, Williams J, Polach K, Chen X, Raman K, Babu YS, Kotian P.. (2022) Scaffold hopping via ring opening enables identification of acyclic compounds as new complement Factor D inhibitors., 74 [PMID:36272185 ] [10.1016/j.bmc.2022.117034 ]