Ethyl 2-([1,1'-Biphenyl]-2-yl)-4-hydroxy-1-(6-methylbenzo[d]thiazol-2-yl)-5-oxo-2,5-dihydro-1H-pyrrole-3-carboxylate

ID: ALA5221132

PubChem CID: 168299899

Max Phase: Preclinical

Molecular Formula: C27H22N2O4S

Molecular Weight: 470.55

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(O)C(=O)N(c2nc3ccc(C)cc3s2)C1c1ccccc1-c1ccccc1

Standard InChI:  InChI=1S/C27H22N2O4S/c1-3-33-26(32)22-23(19-12-8-7-11-18(19)17-9-5-4-6-10-17)29(25(31)24(22)30)27-28-20-14-13-16(2)15-21(20)34-27/h4-15,23,30H,3H2,1-2H3

Standard InChI Key:  RCRDDYVAETVSSX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    0.0742    1.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8992    1.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1493    0.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4958    0.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1716    0.7624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9683    0.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9460    0.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3116    2.2595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3382    2.2595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2895   -0.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8965   -1.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7164   -2.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0708   -2.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6760   -1.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5008   -0.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5293    1.1109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9092    1.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3260    0.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1595   -0.2689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7213   -1.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1339   -0.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9563   -0.4970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3688   -1.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9599   -1.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1355   -1.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1818   -0.2477    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0229   -0.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3083    0.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6606    0.9889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5310   -0.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3260   -0.7735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6116   -0.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1064    0.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9092   -1.3567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  4  1  0
  1  5  1  0
  5  6  1  0
  3  7  1  0
  2  8  1  0
  1  9  2  0
  4 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
  7 16  1  0
 18 17  1  0
 18 16  1  0
  7 19  2  0
 11 20  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 20 25  1  0
 26  6  1  0
 26 27  1  0
 27 28  2  0
 29 28  1  0
  6 29  2  0
 27 30  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 28 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5221132

    ---

Associated Targets(non-human)

murA UDP-N-acetylglucosamine 1-carboxyvinyltransferase (389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.55Molecular Weight (Monoisotopic): 470.1300AlogP: 5.73#Rotatable Bonds: 5
Polar Surface Area: 79.73Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.00CX Basic pKa: CX LogP: 5.88CX LogD: 5.78
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -1.34

References

1. Fathalla RK, Fröhner W, Bader CD, Fischer PD, Dahlem C, Chatterjee D, Mathea S, Kiemer AK, Arthanari H, Müller R, Abdel-Halim M, Ducho C, Engel M..  (2022)  Identification and Biochemical Characterization of Pyrrolidinediones as Novel Inhibitors of the Bacterial Enzyme MurA.,  65  (21.0): [PMID:36269107] [10.1021/acs.jmedchem.2c01275]

Source