The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Ac-D-Ala-Arg{N-omega-(N-methylcarbanoyl)}-N-methyl-Phe-OH ID: ALA522670
PubChem CID: 44572670
Max Phase: Preclinical
Molecular Formula: C23H35N7O6
Molecular Weight: 505.58
Molecule Type: Protein
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)NC(=N)NCCC[C@H](NC(=O)[C@@H](C)NC(C)=O)C(=O)N(C)[C@@H](Cc1ccccc1)C(=O)O
Standard InChI: InChI=1S/C23H35N7O6/c1-14(27-15(2)31)19(32)28-17(11-8-12-26-22(24)29-23(36)25-3)20(33)30(4)18(21(34)35)13-16-9-6-5-7-10-16/h5-7,9-10,14,17-18H,8,11-13H2,1-4H3,(H,27,31)(H,28,32)(H,34,35)(H4,24,25,26,29,36)/t14-,17+,18+/m1/s1
Standard InChI Key: DDYKTARSFHNXGN-JLSDUUJJSA-N
Molfile:
RDKit 2D
36 36 0 0 0 0 0 0 0 0999 V2000
3.7471 -18.2958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4616 -18.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1761 -18.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4616 -19.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7471 -19.9458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1761 -19.9458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8905 -18.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6050 -18.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3195 -18.7083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0340 -18.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7484 -18.7083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0340 -17.4708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4629 -18.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1774 -18.7083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4629 -17.4708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1774 -19.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7471 -20.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0327 -21.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4616 -21.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3182 -20.7708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0327 -22.0083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4616 -22.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7453 -22.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7449 -23.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4599 -23.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1768 -23.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1736 -22.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0327 -19.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7471 -17.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0327 -17.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4616 -17.0583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0327 -16.2333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3182 -17.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7471 -15.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7471 -14.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4616 -16.2333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
17 19 1 1
9 10 1 0
18 20 2 0
2 3 1 1
18 21 1 0
10 11 1 0
19 22 1 0
4 6 2 0
22 23 2 0
10 12 2 0
23 24 1 0
1 2 1 0
24 25 2 0
11 13 1 0
25 26 1 0
3 7 1 0
26 27 2 0
27 22 1 0
13 14 1 0
5 28 1 0
2 4 1 0
1 29 1 0
13 15 2 0
29 30 1 0
7 8 1 0
29 31 2 0
14 16 1 0
30 32 1 0
30 33 1 1
5 17 1 0
32 34 1 0
8 9 1 0
34 35 1 0
17 18 1 0
34 36 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.58Molecular Weight (Monoisotopic): 505.2649AlogP: -0.62#Rotatable Bonds: 12Polar Surface Area: 192.82Molecular Species: ZWITTERIONHBA: 6HBD: 7#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 4.01CX Basic pKa: 9.43CX LogP: -2.69CX LogD: -2.69Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.11Np Likeness Score: -0.12
References 1. Sunazuka T, Sugawara A, Iguchi K, Hirose T, Nagai K, Noguchi Y, Saito Y, Yamamoto T, Ui H, Gouda H, Shiomi K, Watanabe T, Omura S.. (2009) Argifin; efficient solid phase total synthesis and evaluation of analogues of acyclic peptide., 17 (7): [PMID:19297173 ] [10.1016/j.bmc.2009.02.047 ]