3-Oxo-Olean-12-en-29-oic acid N-tert-butylamide

ID: ALA522693

PubChem CID: 10649352

Max Phase: Preclinical

Molecular Formula: C34H55NO2

Molecular Weight: 509.82

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)NC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1

Standard InChI:  InChI=1S/C34H55NO2/c1-28(2,3)35-27(37)31(7)18-17-30(6)19-20-33(9)22(23(30)21-31)11-12-25-32(8)15-14-26(36)29(4,5)24(32)13-16-34(25,33)10/h11,23-25H,12-21H2,1-10H3,(H,35,37)/t23-,24-,25+,30+,31+,32-,33+,34+/m0/s1

Standard InChI Key:  JVQWGVXKERTTBS-DPVXMGEMSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   -5.0244  -15.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0244  -15.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3101  -16.3022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3101  -14.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5958  -15.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5993  -15.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8883  -16.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1691  -15.8986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8812  -14.6518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1695  -15.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1526  -13.4220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8759  -13.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4409  -13.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4548  -14.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7522  -15.0892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0312  -14.6916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7244  -13.4415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0216  -13.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6966  -13.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7184  -12.6553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0157  -12.2271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7089  -12.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6897  -14.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4463  -13.0250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4055  -11.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4222  -11.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1778  -14.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6032  -14.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7406  -16.3074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7319  -17.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6074  -16.7160    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8885  -15.4788    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4630  -15.4913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2471  -11.4979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0012  -10.7938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9042  -17.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6524  -10.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0608  -10.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9318  -10.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3734  -11.1826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8 10  1  0
  9 10  1  0
  3  6  1  0
  5  4  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  5  6  1  0
 18 23  1  1
 17 24  1  1
  9 12  1  0
 21 25  1  1
 10 14  1  0
 21 26  1  0
 13 11  2  0
 10 27  1  1
 11 12  1  0
  5 28  1  1
 13 14  1  0
  2 29  2  0
  1  2  1  0
  3 30  1  0
  1  4  1  0
  6 31  1  6
  2  3  1  0
  9 32  1  6
  5  9  1  0
 14 33  1  6
 13 17  1  0
 14 15  1  0
 26 34  1  0
 26 35  2  0
 15 16  1  0
  3 36  1  0
 16 18  1  0
 34 37  1  0
 17 18  1  0
 37 38  1  0
  6  7  1  0
 37 39  1  0
  7  8  1  0
 37 40  1  0
M  END

Associated Targets(non-human)

Polb DNA polymerase beta (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.82Molecular Weight (Monoisotopic): 509.4233AlogP: 8.27#Rotatable Bonds: 1
Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 0.23CX LogP: 7.63CX LogD: 7.63
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: 2.59

References

1. Sun DA, Starck SR, Locke EP, Hecht SM..  (1999)  DNA polymerase beta inhibitors from Sandoricum koetjape.,  62  (8): [PMID:10479314] [10.1021/np990104r]

Source