cyclocitrinol

ID: ALA523073

PubChem CID: 44587547

Max Phase: Preclinical

Molecular Formula: C25H36O4

Molecular Weight: 400.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms: Cyclocitrinol | cyclocitrinol|CHEMBL523073

Canonical SMILES:  C[C@@H](O)/C=C/[C@](C)(O)[C@H]1CC[C@H]2C3=CC(=O)[C@H]4CC(=CC[C@H](O)C4)[C@H]3CC[C@@]21C

Standard InChI:  InChI=1S/C25H36O4/c1-15(26)8-11-25(3,29)23-7-6-21-20-14-22(28)17-12-16(4-5-18(27)13-17)19(20)9-10-24(21,23)2/h4,8,11,14-15,17-19,21,23,26-27,29H,5-7,9-10,12-13H2,1-3H3/b11-8+/t15-,17+,18+,19-,21+,23+,24+,25+/m1/s1

Standard InChI Key:  QZAMIRPHNVBTIV-HRXCHONESA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    8.8865   -0.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4996   -1.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1115   -1.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9366   -1.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4848   -0.8196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0636   -0.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5872   -1.6439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3371   -1.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2932   -2.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8945   -2.0858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2205   -2.6106    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6561   -0.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3720   -0.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3621    1.2137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6485    0.7987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0738    0.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0749   -0.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8590   -0.2777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3465    0.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8598    1.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1614    1.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9138    1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4972    1.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2789    1.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8622    0.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1604   -0.8432    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9728    0.4410    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.2417   -2.6162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5477    2.4352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5306    2.3805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6800    1.0615    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.1268    1.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5393    2.5663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 12  1  0
 13  2  2  0
  2  4  1  0
  3  4  1  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  1  8  1  0
  7  9  1  0
  8  3  1  0
  9  3  1  0
  7 10  1  1
  3 11  1  1
 12 13  1  0
 12 15  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 16 21  1  1
 20 32  1  0
 32 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 17 26  1  6
 12 27  1  6
  4 28  2  0
 32 29  1  1
 24 30  1  6
 20 31  1  6
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA523073

    CYCLOCITRINOL

Associated Targets(Human)

GPR12 Tbio G-protein coupled receptor 12 (6 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

CHO (4503 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.56Molecular Weight (Monoisotopic): 400.2614AlogP: 3.71#Rotatable Bonds: 3
Polar Surface Area: 77.76Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.73CX LogD: 2.73
Aromatic Rings: Heavy Atoms: 29QED Weighted: 0.63Np Likeness Score: 3.34

References

1. Du L, Zhu T, Fang Y, Gu Q, Zhu W..  (2008)  Unusual C25 steroid isomers with bicyclo[4.4.1]A/B rings from a volcano ash-derived fungus Penicillium citrinum.,  71  (8): [PMID:18656987] [10.1021/np8000442]

Source